Difference between revisions of "Tiso gene 5199"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11410 CPD-11410] == * smiles: ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-]...")
(Created page with "Category:Gene == Gene Tiso_gene_5199 == * right end position: ** 13641 * transcription direction: ** POSITIVE * left end position: ** 10190 * centisome position: ** 73.867...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11410 CPD-11410] ==
+
== Gene Tiso_gene_5199 ==
−
* smiles:
+
* right end position:
−
** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C=C3))
+
** 13641
−
* common name:
+
* transcription direction:
−
** triiodothyroacetate ether glucuronide
+
** POSITIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=VXVBZMWOWMHXTQ-KFYUBCHVSA-L
+
** 10190
−
* molecular weight:
+
* centisome position:
−
** 796.046    
+
** 73.86735    
 
* Synonym(s):
 
* Synonym(s):
−
** triiodothyroacetic acid ether glucuronide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]]
−
* [[RXN-10619]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=13641}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659025 90659025]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C=C3))}}
+
{{#set: left end position=10190}}
−
{{#set: common name=triiodothyroacetate ether glucuronide}}
+
{{#set: centisome position=73.86735   }}
−
{{#set: inchi key=InChIKey=VXVBZMWOWMHXTQ-KFYUBCHVSA-L}}
+
{{#set: reaction associated=NAD+-ADP-RIBOSYLTRANSFERASE-RXN}}
−
{{#set: molecular weight=796.046   }}
+
−
{{#set: common name=triiodothyroacetic acid ether glucuronide}}
+
−
{{#set: produced by=RXN-10619}}
+

Latest revision as of 20:08, 21 March 2018

Gene Tiso_gene_5199

  • right end position:
    • 13641
  • transcription direction:
    • POSITIVE
  • left end position:
    • 10190
  • centisome position:
    • 73.86735
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_5199&oldid=46294"