Difference between revisions of "RXN66-483"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-AMINO-BENZOATE P-AMINO-BENZOATE] == * smiles: ** C(=O)([O-])C1(C=CC(=CC=1)N) * inchi key: **...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-483 RXN66-483] == * direction: ** LEFT-TO-RIGHT * common name: ** polyketide_synthase ** long...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-AMINO-BENZOATE P-AMINO-BENZOATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-483 RXN66-483] ==
−
* smiles:
+
* direction:
−
** C(=O)([O-])C1(C=CC(=CC=1)N)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=ALYNCZNDIQEVRV-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** 4-aminobenzoate
+
** polyketide_synthase
−
* molecular weight:
+
** long_chain_acyl-_synthetase
−
** 136.13   
+
** ORF
 +
** acyl-_synthetase
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/6.2.1.3 EC-6.2.1.3]
 
* Synonym(s):
 
* Synonym(s):
−
** para-aminobenzoic acid
 
−
** p-aminobenzoic acid
 
−
** para-aminobenzoate
 
−
** p-aminobenzoate
 
−
** 4-aminobenzoic acid
 
−
** pABA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[H2PTEROATESYNTH-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[2-Me-Branched-234-Sat-FA]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[CO-A]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[AMP]][c] '''+''' 1 [[2-Me-Branched-234-Sat-Fatty-Acyl-CoA]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[ADCLY-RXN]]
+
** 1 a 2-methyl branched 2,3,4-saturated fatty acid[c] '''+''' 1 ATP[c] '''+''' 1 coenzyme A[c] '''=>''' 1 diphosphate[c] '''+''' 1 AMP[c] '''+''' 1 a 2-methyl branched 2,3,4-saturated fatty acyl-CoA[c]
−
* [[RXN-14226]]
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_500]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_348]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_13394]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_4191]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_135]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_136]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_10876]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_9394]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_7855]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY66-387]], fatty acid α-oxidation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-387 PWY66-387]
 +
** '''4''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 150-13-0
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=polyketide_synthase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4876 4876]
+
{{#set: common name=long_chain_acyl-_synthetase}}
−
* HMDB : HMDB01392
+
{{#set: common name=ORF}}
−
* LIGAND-CPD:
+
{{#set: common name=acyl-_synthetase}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00568 C00568]
+
{{#set: ec number=EC-6.2.1.3}}
−
* CHEMSPIDER:
+
{{#set: gene associated=Tiso_gene_500|Tiso_gene_348|Tiso_gene_13394|Tiso_gene_4191|Tiso_gene_135|Tiso_gene_136|Tiso_gene_10876|Tiso_gene_9394|Tiso_gene_7855}}
−
** [http://www.chemspider.com/Chemical-Structure.4710.html 4710]
+
{{#set: in pathway=PWY66-387}}
−
* CHEBI:
+
{{#set: reconstruction category=orthology|annotation}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17836 17836]
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}}
−
* BIGG : 4abz
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: smiles=C(=O)([O-])C1(C=CC(=CC=1)N)}}
+
−
{{#set: inchi key=InChIKey=ALYNCZNDIQEVRV-UHFFFAOYSA-M}}
+
−
{{#set: common name=4-aminobenzoate}}
+
−
{{#set: molecular weight=136.13    }}
+
−
{{#set: common name=para-aminobenzoic acid|p-aminobenzoic acid|para-aminobenzoate|p-aminobenzoate|4-aminobenzoic acid|pABA}}
+
−
{{#set: consumed by=H2PTEROATESYNTH-RXN}}
+
−
{{#set: reversible reaction associated=ADCLY-RXN|RXN-14226}}
+

Latest revision as of 20:08, 21 March 2018

Reaction RXN66-483

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • polyketide_synthase
    • long_chain_acyl-_synthetase
    • ORF
    • acyl-_synthetase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY66-387, fatty acid α-oxidation II: PWY66-387
    • 4 reactions found over 6 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN66-483&oldid=46305"