Difference between revisions of "LINAMARIN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8162 RXN-8162] == * direction: ** LEFT-TO-RIGHT * common name: ** polyketide_synthase * Synonym...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINAMARIN LINAMARIN] == * smiles: ** CC(C)(C#N)OC1(OC(CO)C(O)C(O)C(O)1) * common name: ** linam...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8162 RXN-8162] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINAMARIN LINAMARIN] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)(C#N)OC1(OC(CO)C(O)C(O)C(O)1)
 
* common name:
 
* common name:
−
** polyketide_synthase
+
** linamarin
 +
* inchi key:
 +
** InChIKey=QLTCHMYAEJEXBT-ZEBDFXRSSA-N
 +
* molecular weight:
 +
** 247.247   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-(β-D-glucopyranosyloxy)-2-methylpropanenitrile
 +
** 1-cyano-1-methylethyl beta-D-glucoside
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-5341]]
−
** 1 [[CPD-7682]][c] '''+''' 1 [[NAD]][c] '''+''' 2 [[WATER]][c] '''=>''' 1 [[CPD-468]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-13602]]
−
** 1 (S)-2,3,4,5-tetrahydropiperidine-2-carboxylate[c] '''+''' 1 NAD+[c] '''+''' 2 H2O[c] '''=>''' 1 L-2-aminoadipate[c] '''+''' 1 H+[c] '''+''' 1 NADH[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_6563]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-5283]], L-lysine degradation V: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5283 PWY-5283]
+
−
** '''2''' reactions found over '''9''' reactions in the full pathway
+
−
* [[PWY-5298]], L-lysine degradation VI: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5298 PWY-5298]
+
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CAS : 554-35-8
−
{{#set: common name=polyketide_synthase}}
+
* PUBCHEM:
−
{{#set: gene associated=Tiso_gene_6563}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11128 11128]
−
{{#set: in pathway=PWY-5283|PWY-5298}}
+
* HMDB : HMDB33699
−
{{#set: reconstruction category=annotation}}
+
* LIGAND-CPD:
−
{{#set: reconstruction tool=pathwaytools}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01594 C01594]
−
{{#set: reconstruction source=in-silico_annotation}}
+
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.10657.html 10657]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16441 16441]
 +
{{#set: smiles=CC(C)(C#N)OC1(OC(CO)C(O)C(O)C(O)1)}}
 +
{{#set: common name=linamarin}}
 +
{{#set: inchi key=InChIKey=QLTCHMYAEJEXBT-ZEBDFXRSSA-N}}
 +
{{#set: molecular weight=247.247    }}
 +
{{#set: common name=2-(β-D-glucopyranosyloxy)-2-methylpropanenitrile|1-cyano-1-methylethyl beta-D-glucoside}}
 +
{{#set: consumed by=RXN-5341}}
 +
{{#set: produced by=RXN-13602}}

Latest revision as of 21:08, 21 March 2018

Metabolite LINAMARIN

  • smiles:
    • CC(C)(C#N)OC1(OC(CO)C(O)C(O)C(O)1)
  • common name:
    • linamarin
  • inchi key:
    • InChIKey=QLTCHMYAEJEXBT-ZEBDFXRSSA-N
  • molecular weight:
    • 247.247
  • Synonym(s):
    • 2-(β-D-glucopyranosyloxy)-2-methylpropanenitrile
    • 1-cyano-1-methylethyl beta-D-glucoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=LINAMARIN&oldid=46312"