Difference between revisions of "Tiso gene 11263"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-29 CPDQT-29] == * smiles: ** CSCCCCCCC(=O)C([O-])=O * inchi key: ** InChIKey=QDZNKMGEHAHO...")
(Created page with "Category:Gene == Gene Tiso_gene_11263 == * Synonym(s): == Reactions associated == * Reaction: ADCPT ** Source: orthology-creinhardtii == Pathways associated == ==...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-29 CPDQT-29] ==
+
== Gene Tiso_gene_11263 ==
* smiles:
+
** CSCCCCCCC(=O)C([O-])=O
+
* inchi key:
+
** InChIKey=QDZNKMGEHAHOTA-UHFFFAOYSA-M
+
* common name:
+
** 8-(methylthio)-2-oxooctanoate
+
* molecular weight:
+
** 203.276   
+
 
* Synonym(s):
 
* Synonym(s):
** 8-(methylthio)-2-oxooctanoic acid
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ADCPT]]
* [[RXN-18205]]
+
** Source: [[orthology-creinhardtii]]
* [[RXNQT-4171]]
+
== Pathways associated ==
== Reaction(s) of unknown directionality ==
+
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=ADCPT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237313 44237313]
+
* KNAPSACK : C00007643
+
{{#set: smiles=CSCCCCCCC(=O)C([O-])=O}}
+
{{#set: inchi key=InChIKey=QDZNKMGEHAHOTA-UHFFFAOYSA-M}}
+
{{#set: common name=8-(methylthio)-2-oxooctanoate}}
+
{{#set: molecular weight=203.276    }}
+
{{#set: common name=8-(methylthio)-2-oxooctanoic acid}}
+
{{#set: produced by=RXN-18205|RXNQT-4171}}
+

Latest revision as of 20:08, 21 March 2018

Gene Tiso_gene_11263

  • Synonym(s):

Reactions associated

Pathways associated

External links