Difference between revisions of "Peptides-with-Leader-Sequence"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19144 CPD-19144] == * smiles: ** CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Peptides-with-Leader-Sequence Peptides-with-Leader-Sequence] == * common name: ** a peptide wit...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19144 CPD-19144] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Peptides-with-Leader-Sequence Peptides-with-Leader-Sequence] ==
* smiles:
+
** CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=MJWMOLDKMBISOB-YDGGZUKGSA-J
+
 
* common name:
 
* common name:
** (7Z)-hexadecenoyl-CoA
+
** a peptide with a leader sequence
* molecular weight:
+
** 999.899   
+
 
* Synonym(s):
 
* Synonym(s):
** cis-hexadec-7-enoyl-CoA
 
** (7Z)-hexadec-7-enoyl-CoA
 
** 16:1 cis-7
 
** 16:1(n-9)
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17779]]
+
* [[3.4.21.89-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17778]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: common name=a peptide with a leader sequence}}
{{#set: inchi key=InChIKey=MJWMOLDKMBISOB-YDGGZUKGSA-J}}
+
{{#set: consumed by=3.4.21.89-RXN}}
{{#set: common name=(7Z)-hexadecenoyl-CoA}}
+
{{#set: molecular weight=999.899    }}
+
{{#set: common name=cis-hexadec-7-enoyl-CoA|(7Z)-hexadec-7-enoyl-CoA|16:1 cis-7|16:1(n-9)}}
+
{{#set: consumed by=RXN-17779}}
+
{{#set: produced by=RXN-17778}}
+

Latest revision as of 21:09, 21 March 2018

Metabolite Peptides-with-Leader-Sequence

  • common name:
    • a peptide with a leader sequence
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links