Difference between revisions of "Tiso gene 19914"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13375 CPD-13375] == * smiles: ** C1(C(C(C(C(O1)OCC2(OC(C(O)C(O)C(O)2)OC4(C(O)C(O)C(OC(COC3(...")
(Created page with "Category:Gene == Gene Tiso_gene_19914 == * right end position: ** 713 * transcription direction: ** POSITIVE * left end position: ** 3 * centisome position: ** 0.155521...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13375 CPD-13375] ==
+
== Gene Tiso_gene_19914 ==
* smiles:
+
* right end position:
** C1(C(C(C(C(O1)OCC2(OC(C(O)C(O)C(O)2)OC4(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)O))4)OC6(C(O)C(O)C(OC(COC5(C(C(C(CO5)O)O)O))6)OC7(C(O)C(O)C(O)OC(CO)7)))))O)O)O)
+
** 713
* inchi key:
+
* transcription direction:
** InChIKey=PZUPAGRIHCRVKN-SPHBQONKSA-N
+
** POSITIVE
* common name:
+
* left end position:
** XXXG xyloglucan oligosaccharide
+
** 3
* molecular weight:
+
* centisome position:
** 1062.931    
+
** 0.155521    
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
* [[RXN-12400]]
+
** Source: [[annotation-in-silico_annotation]]
* [[RXN-12399]]
+
*** Assignment: ec-number
* [[RXN-12398]]
+
== Pathways associated ==
== Reaction(s) of unknown directionality ==
+
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=713}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940180 52940180]
+
{{#set: transcription direction=POSITIVE}}
{{#set: smiles=C1(C(C(C(C(O1)OCC2(OC(C(O)C(O)C(O)2)OC4(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)O))4)OC6(C(O)C(O)C(OC(COC5(C(C(C(CO5)O)O)O))6)OC7(C(O)C(O)C(O)OC(CO)7)))))O)O)O)}}
+
{{#set: left end position=3}}
{{#set: inchi key=InChIKey=PZUPAGRIHCRVKN-SPHBQONKSA-N}}
+
{{#set: centisome position=0.155521   }}
{{#set: common name=XXXG xyloglucan oligosaccharide}}
+
{{#set: reaction associated=DNA-DIRECTED-RNA-POLYMERASE-RXN}}
{{#set: molecular weight=1062.931   }}
+
{{#set: produced by=RXN-12400|RXN-12399|RXN-12398}}
+

Latest revision as of 21:09, 21 March 2018

Gene Tiso_gene_19914

  • right end position:
    • 713
  • transcription direction:
    • POSITIVE
  • left end position:
    • 3
  • centisome position:
    • 0.155521
  • Synonym(s):

Reactions associated

Pathways associated

External links