Difference between revisions of "3-HYDROXY-PROPIONYL-COA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LI+ LI+] == * smiles: ** [Li+] * inchi key: ** InChIKey=HBBGRARXTFLTSG-UHFFFAOYSA-N * common na...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-PROPIONYL-COA 3-HYDROXY-PROPIONYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-PROPIONYL-COA 3-HYDROXY-PROPIONYL-COA] == |
* smiles: | * smiles: | ||
| − | ** [ | + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCO)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 3-hydroxypropanoyl-CoA |
| + | * inchi key: | ||
| + | ** InChIKey=BERBFZCUSMQABM-IEXPHMLFSA-J | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 835.566 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 3-hydroxypropionyl-coenzyme A |
| + | ** 3-hydroxypropionyl-CoA | ||
| + | ** 3-hydroxypropanoyl coenzymeA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-6384]] |
| + | * [[HICH]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[RXN-6383]] |
== External links == | == External links == | ||
| − | * | + | * LIGAND-CPD: |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05668 C05668] | |
| − | ** [http:// | + | * HMDB : HMDB06807 |
| − | * | + | |
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58528 58528] |
| − | * | + | * METABOLIGHTS : MTBLC58528 |
| − | {{#set: smiles=[ | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229175 44229175] |
| − | {{#set: | + | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCO)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| − | {{#set: molecular weight= | + | {{#set: common name=3-hydroxypropanoyl-CoA}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=BERBFZCUSMQABM-IEXPHMLFSA-J}} |
| − | {{#set: consumed by= | + | {{#set: molecular weight=835.566 }} |
| − | + | {{#set: common name=3-hydroxypropionyl-coenzyme A|3-hydroxypropionyl-CoA|3-hydroxypropanoyl coenzymeA}} | |
| − | {{#set: reversible reaction associated= | + | {{#set: consumed by=RXN-6384|HICH}} |
| + | {{#set: reversible reaction associated=RXN-6383}} | ||
Latest revision as of 20:09, 21 March 2018
Contents
Metabolite 3-HYDROXY-PROPIONYL-COA
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCO)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- 3-hydroxypropanoyl-CoA
- inchi key:
- InChIKey=BERBFZCUSMQABM-IEXPHMLFSA-J
- molecular weight:
- 835.566
- Synonym(s):
- 3-hydroxypropionyl-coenzyme A
- 3-hydroxypropionyl-CoA
- 3-hydroxypropanoyl coenzymeA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCO)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
