Difference between revisions of "N-TETRADECANOYLGLYCYL-PEPTIDE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYGUANOSINE DEOXYGUANOSINE] == * smiles: ** C(O)C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-TETRADECANOYLGLYCYL-PEPTIDE N-TETRADECANOYLGLYCYL-PEPTIDE] == * smiles: ** CCCCCCCCCCCCCC(=O)...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-TETRADECANOYLGLYCYL-PEPTIDE N-TETRADECANOYLGLYCYL-PEPTIDE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCCCCCCCCCCCCC(=O)C(N)C(=O)NC([R])C(=O)O |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** N-tetradecanoylglycyl-peptide |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[2.3.1.97-RXN]] |
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03881 C03881] |
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17739 17739] |
| − | + | {{#set: smiles=CCCCCCCCCCCCCC(=O)C(N)C(=O)NC([R])C(=O)O}} | |
| − | {{#set: smiles= | + | {{#set: common name=N-tetradecanoylglycyl-peptide}} |
| − | {{#set: | + | {{#set: reversible reaction associated=2.3.1.97-RXN}} |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
Latest revision as of 20:09, 21 March 2018
Contents
Metabolite N-TETRADECANOYLGLYCYL-PEPTIDE
- smiles:
- CCCCCCCCCCCCCC(=O)C(N)C(=O)NC([R])C(=O)O
- common name:
- N-tetradecanoylglycyl-peptide
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCCCCCCC(=O)C(N)C(=O)NC([R])C(=O)O" cannot be used as a page name in this wiki.
