Difference between revisions of "CPD-7221"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Damaged-DNA-Pyrimidine Damaged-DNA-Pyrimidine] == * common name: ** a damaged DNA pyrimidine *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7221 CPD-7221] == * smiles: ** CCCCCCCCC=CCC(SCCNC(CCNC(C(C(COP(OP(OCC3(C(OP(=O)([O-])[O-])...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7221 CPD-7221] == |
| + | * smiles: | ||
| + | ** CCCCCCCCC=CCC(SCCNC(CCNC(C(C(COP(OP(OCC3(C(OP(=O)([O-])[O-])C(O)C(N2(C1(N=CN=C(N)C=1N=C2)))O3))(=O)[O-])(=O)[O-])(C)C)O)=O)=O)=O | ||
* common name: | * common name: | ||
| − | ** | + | ** 3-cis-dodecenoyl-CoA |
| + | * inchi key: | ||
| + | ** InChIKey=XEMIVMKTVGRFTD-QXMHVHEDSA-J | ||
| + | * molecular weight: | ||
| + | ** 943.792 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 12:1(n-9) | ||
| + | ** 12:1 cis-3 | ||
| + | ** cis-3-dodecenoyl-CoA | ||
| + | ** (3Z)-dodecenoyl-CoA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-14394]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659197 90659197] |
| + | * HMDB : HMDB04257 | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27989 27989] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C02944 C02944] | ||
| + | {{#set: smiles=CCCCCCCCC=CCC(SCCNC(CCNC(C(C(COP(OP(OCC3(C(OP(=O)([O-])[O-])C(O)C(N2(C1(N=CN=C(N)C=1N=C2)))O3))(=O)[O-])(=O)[O-])(C)C)O)=O)=O)=O}} | ||
| + | {{#set: common name=3-cis-dodecenoyl-CoA}} | ||
| + | {{#set: inchi key=InChIKey=XEMIVMKTVGRFTD-QXMHVHEDSA-J}} | ||
| + | {{#set: molecular weight=943.792 }} | ||
| + | {{#set: common name=12:1(n-9)|12:1 cis-3|cis-3-dodecenoyl-CoA|(3Z)-dodecenoyl-CoA}} | ||
| + | {{#set: produced by=RXN-14394}} | ||
Latest revision as of 20:09, 21 March 2018
Contents
Metabolite CPD-7221
- smiles:
- CCCCCCCCC=CCC(SCCNC(CCNC(C(C(COP(OP(OCC3(C(OP(=O)([O-])[O-])C(O)C(N2(C1(N=CN=C(N)C=1N=C2)))O3))(=O)[O-])(=O)[O-])(C)C)O)=O)=O)=O
- common name:
- 3-cis-dodecenoyl-CoA
- inchi key:
- InChIKey=XEMIVMKTVGRFTD-QXMHVHEDSA-J
- molecular weight:
- 943.792
- Synonym(s):
- 12:1(n-9)
- 12:1 cis-3
- cis-3-dodecenoyl-CoA
- (3Z)-dodecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCC=CCC(SCCNC(CCNC(C(C(COP(OP(OCC3(C(OP(=O)([O-])[O-])C(O)C(N2(C1(N=CN=C(N)C=1N=C2)))O3))(=O)[O-])(=O)[O-])(C)C)O)=O)=O)=O" cannot be used as a page name in this wiki.
