Difference between revisions of "CPD-308"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_2193 == * Synonym(s): == Reactions associated == * R93 ** pantograph-synechocystis * R94 ** pantograph-synechocystis...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-308 CPD-308] == * smiles: ** C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O * commo...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_2193 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-308 CPD-308] ==
 +
* smiles:
 +
** C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O
 +
* common name:
 +
** D-nopaline
 +
* inchi key:
 +
** InChIKey=LMKYZBGVKHTLTN-NKWVEPMBSA-M
 +
* molecular weight:
 +
** 303.294   
 
* Synonym(s):
 
* Synonym(s):
 +
** N2-(D-1,3-dicarboxypropyl)-L-arginine
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[R93]]
+
== Reaction(s) known to produce the compound ==
** [[pantograph]]-[[synechocystis]]
+
* [[1.5.1.19-RXN]]
* [[R94]]
+
== Reaction(s) of unknown directionality ==
** [[pantograph]]-[[synechocystis]]
+
* [[RXN-8024]]
+
** [[pantograph]]-[[esiliculosus]]
+
== Pathways associated ==
+
* [[PWY-6287]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=R93|R94|RXN-8024}}
+
* PUBCHEM:
{{#set: pathway associated=PWY-6287}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791983 49791983]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58074 58074]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C01682 C01682]
 +
{{#set: smiles=C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O}}
 +
{{#set: common name=D-nopaline}}
 +
{{#set: inchi key=InChIKey=LMKYZBGVKHTLTN-NKWVEPMBSA-M}}
 +
{{#set: molecular weight=303.294    }}
 +
{{#set: common name=N2-(D-1,3-dicarboxypropyl)-L-arginine}}
 +
{{#set: produced by=1.5.1.19-RXN}}

Latest revision as of 21:09, 21 March 2018

Metabolite CPD-308

  • smiles:
    • C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O
  • common name:
    • D-nopaline
  • inchi key:
    • InChIKey=LMKYZBGVKHTLTN-NKWVEPMBSA-M
  • molecular weight:
    • 303.294
  • Synonym(s):
    • N2-(D-1,3-dicarboxypropyl)-L-arginine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O" cannot be used as a page name in this wiki.