Difference between revisions of "Tiso gene 19475"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CITRULLINE L-CITRULLINE] == * smiles: ** C(NC(N)=O)CCC([N+])C(=O)[O-] * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene Tiso_gene_19475 == * right end position: ** 2194 * transcription direction: ** POSITIVE * left end position: ** 2 * centisome position: ** 8.71839600...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_19475 == |
− | * | + | * right end position: |
− | ** | + | ** 2194 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 2 |
− | * | + | * centisome position: |
− | ** | + | ** 8.71839600e-2 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[PEPCARBOXYKIN-RXN]] |
− | + | ** Source: [[annotation-experimental_annotation]] | |
− | == | + | *** Assignment: automated-name-match |
− | * [[ | + | ** Source: [[orthology-athaliana]] |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-561]] | ||
+ | * [[GLUCONEO-PWY]] | ||
+ | * [[PWY-7117]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=2194}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=2}} | |
− | + | {{#set: centisome position=8.71839600e-2}} | |
− | + | {{#set: reaction associated=PEPCARBOXYKIN-RXN}} | |
− | + | {{#set: pathway associated=PWY-561|GLUCONEO-PWY|PWY-7117}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:09, 21 March 2018
Gene Tiso_gene_19475
- right end position:
- 2194
- transcription direction:
- POSITIVE
- left end position:
- 2
- centisome position:
- 8.71839600e-2
- Synonym(s):
Reactions associated
- Reaction: PEPCARBOXYKIN-RXN
- Source: annotation-experimental_annotation
- Assignment: automated-name-match
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Source: orthology-creinhardtii
- Source: annotation-experimental_annotation