Difference between revisions of "Tiso gene 6340"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-308 CPD-308] == * smiles: ** C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O * inchi...") |
(Created page with "Category:Gene == Gene Tiso_gene_6340 == * right end position: ** 1464 * transcription direction: ** POSITIVE * left end position: ** 66 * centisome position: ** 0.53610593...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_6340 == |
− | * | + | * right end position: |
− | ** | + | ** 1464 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 66 |
− | * | + | * centisome position: |
− | ** | + | ** 0.53610593 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[D-THREO-ALDOSE-1-DEHYDROGENASE-RXN]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: ec-number |
+ | * Reaction: [[PYRIDOXAL-4-DEHYDROGENASE-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-5499]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=1464}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=66}} | |
− | + | {{#set: centisome position=0.53610593 }} | |
− | + | {{#set: reaction associated=D-THREO-ALDOSE-1-DEHYDROGENASE-RXN|PYRIDOXAL-4-DEHYDROGENASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-5499}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:09, 21 March 2018
Gene Tiso_gene_6340
- right end position:
- 1464
- transcription direction:
- POSITIVE
- left end position:
- 66
- centisome position:
- 0.53610593
- Synonym(s):
Reactions associated
- Reaction: D-THREO-ALDOSE-1-DEHYDROGENASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: PYRIDOXAL-4-DEHYDROGENASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation