Difference between revisions of "RXN-6321"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1083 CPD-1083] == * smiles: ** CC=C(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6321 RXN-6321] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With id...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1083 CPD-1083] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6321 RXN-6321] ==
* smiles:
+
* direction:
** CC=C(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=PMWATMXOQQZNBX-DKBZLLMOSA-J
+
* common name:
+
** (E)-2-methylcrotonoyl-CoA
+
* molecular weight:
+
** 845.604   
+
 
* Synonym(s):
 
* Synonym(s):
** methylcrotonyl-CoA
 
** trans-2-methylbut-2-enoyl-CoA
 
** 2-methylbut-2-enoyl-CoA
 
** tigloyl-CoA
 
** tiglyl-CoA
 
** 2-methyl-crotonyl-CoA
 
** (E)-2-methylbut-2-enoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[MCDH_2mb2coa]]
+
** 1 [[WATER]][c] '''+''' 1 [[5-10-METHENYL-THF-GLU-N]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[N5-Formyl-THF-Glu-N]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
* [[TIGLYLCOA-HYDROXY-RXN]]
+
** 1 H2O[c] '''+''' 1 a 5,10-methenyltetrahydrofolate[c] '''=>''' 1 H+[c] '''+''' 1 an (6S)-N5-formyl-tetrahydrofolate[c]
* [[RXN-14266]]
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_17287]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-3841]], folate transformations II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3841 PWY-3841]
 +
** '''9''' reactions found over '''11''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* CAS : 6247-62-7
+
* RHEA:
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=34767 34767]
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266534 45266534]
+
* LIGAND-RXN:
* CHEBI:
+
** [http://www.genome.jp/dbget-bin/www_bget?R02300 R02300]
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15478 15478]
+
{{#set: direction=LEFT-TO-RIGHT}}
* LIGAND-CPD:
+
{{#set: gene associated=Tiso_gene_17287}}
** [http://www.genome.jp/dbget-bin/www_bget?C03345 C03345]
+
{{#set: in pathway=PWY-3841}}
* HMDB : HMDB02054
+
{{#set: reconstruction category=orthology}}
{{#set: smiles=CC=C(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reconstruction source=orthology-esiliculosus}}
{{#set: inchi key=InChIKey=PMWATMXOQQZNBX-DKBZLLMOSA-J}}
+
{{#set: reconstruction tool=pantograph}}
{{#set: common name=(E)-2-methylcrotonoyl-CoA}}
+
{{#set: molecular weight=845.604    }}
+
{{#set: common name=methylcrotonyl-CoA|trans-2-methylbut-2-enoyl-CoA|2-methylbut-2-enoyl-CoA|tigloyl-CoA|tiglyl-CoA|2-methyl-crotonyl-CoA|(E)-2-methylbut-2-enoyl-CoA}}
+
{{#set: produced by=MCDH_2mb2coa}}
+
{{#set: consumed or produced by=TIGLYLCOA-HYDROXY-RXN|RXN-14266}}
+

Latest revision as of 20:09, 21 March 2018

Reaction RXN-6321

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-3841, folate transformations II: PWY-3841
    • 9 reactions found over 11 reactions in the full pathway

Reconstruction information

External links