Difference between revisions of "PYRIDOXINE-5P"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_18146 == * Synonym(s): == Reactions associated == * Reaction: TRANS-RXN-101 ** Source: orthology-creinhardtii ** Source: ortholo...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXINE-5P PYRIDOXINE-5P] == * smiles: ** CC1(=NC=C(COP([O-])(=O)[O-])C(=C(O)1)CO) * common...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXINE-5P PYRIDOXINE-5P] == |
+ | * smiles: | ||
+ | ** CC1(=NC=C(COP([O-])(=O)[O-])C(=C(O)1)CO) | ||
+ | * common name: | ||
+ | ** pyridoxine 5'-phosphate | ||
+ | * inchi key: | ||
+ | ** InChIKey=WHOMFKWHIQZTHY-UHFFFAOYSA-L | ||
+ | * molecular weight: | ||
+ | ** 247.144 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** pyridoxol 5'-phosphate | ||
+ | ** pyridoxine 5-phosphate | ||
+ | ** pyridoxine phosphate | ||
+ | ** pyridoxine-5P | ||
+ | ** pyridoxine-P | ||
+ | ** [5-hydroxy-4-(hydroxymethyl)-6-methylpyridin-3-yl]methyl phosphate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[PNPOXI-RXN]] |
− | * | + | * [[RXN-14181]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | == | + | * [[PNKIN-RXN]] |
+ | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 447-05-2 |
+ | * BIGG : pdx5p | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24794348 24794348] | ||
+ | * HMDB : HMDB01319 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00627 C00627] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58589 58589] | ||
+ | * METABOLIGHTS : MTBLC58589 | ||
+ | {{#set: smiles=CC1(=NC=C(COP([O-])(=O)[O-])C(=C(O)1)CO)}} | ||
+ | {{#set: common name=pyridoxine 5'-phosphate}} | ||
+ | {{#set: inchi key=InChIKey=WHOMFKWHIQZTHY-UHFFFAOYSA-L}} | ||
+ | {{#set: molecular weight=247.144 }} | ||
+ | {{#set: common name=pyridoxol 5'-phosphate|pyridoxine 5-phosphate|pyridoxine phosphate|pyridoxine-5P|pyridoxine-P|[5-hydroxy-4-(hydroxymethyl)-6-methylpyridin-3-yl]methyl phosphate}} | ||
+ | {{#set: consumed by=PNPOXI-RXN|RXN-14181}} | ||
+ | {{#set: produced by=PNKIN-RXN}} |
Latest revision as of 21:09, 21 March 2018
Contents
Metabolite PYRIDOXINE-5P
- smiles:
- CC1(=NC=C(COP([O-])(=O)[O-])C(=C(O)1)CO)
- common name:
- pyridoxine 5'-phosphate
- inchi key:
- InChIKey=WHOMFKWHIQZTHY-UHFFFAOYSA-L
- molecular weight:
- 247.144
- Synonym(s):
- pyridoxol 5'-phosphate
- pyridoxine 5-phosphate
- pyridoxine phosphate
- pyridoxine-5P
- pyridoxine-P
- [5-hydroxy-4-(hydroxymethyl)-6-methylpyridin-3-yl]methyl phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 447-05-2
- BIGG : pdx5p
- PUBCHEM:
- HMDB : HMDB01319
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC58589
"CC1(=NC=C(COP([O-])(=O)[O-])C(=C(O)1)CO)" cannot be used as a page name in this wiki.
"5-hydroxy-4-(hydroxymethyl)-6-methylpyridin-3-yl]methyl phosphate" cannot be used as a page name in this wiki.