Difference between revisions of "RXN1G-1050"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROHYDROXYPHOSPHORYLPYRUVATE 3-HYDROHYDROXYPHOSPHORYLPYRUVATE] == * smiles: ** C([O-])(=O)C...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1050 RXN1G-1050] == * direction: ** LEFT-TO-RIGHT * common name: ** cis,cis-delta13,31-3-oxo-...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1050 RXN1G-1050] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** cis,cis-delta13,31-3-oxo-C50:2-[acyl-carrier protein] reductase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/1.1.1.M9 EC-1.1.1.M9] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | * [[ | + | ** 1 [[NADPH]][c] '''+''' 1 [[cis-cis-D13-31-3-oxo-C50-2-ACPs]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[cis-cis-D13-31-3-hydroxyC50-2-ACPs]][c] '''+''' 1 [[NADP]][c] |
| − | == | + | * With common name(s): |
| − | * [[ | + | ** 1 NADPH[c] '''+''' 1 a cis,cis-delta13,31-3-oxo-C50:2-[acp][c] '''+''' 1 H+[c] '''=>''' 1 a cis,cis-delta13,31-3-hydroxy C50:2-[acp][c] '''+''' 1 NADP+[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_13083]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | == Pathways == | ||
| + | * [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321] | ||
| + | ** '''86''' reactions found over '''182''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=cis,cis-delta13,31-3-oxo-C50:2-[acyl-carrier protein] reductase}} | |
| − | + | {{#set: ec number=EC-1.1.1.M9}} | |
| − | + | {{#set: gene associated=Tiso_gene_13083}} | |
| − | + | {{#set: in pathway=PWYG-321}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction source=orthology-esiliculosus}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 21:10, 21 March 2018
Contents
Reaction RXN1G-1050
- direction:
- LEFT-TO-RIGHT
- common name:
- cis,cis-delta13,31-3-oxo-C50:2-[acyl-carrier protein] reductase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 NADPH[c] + 1 cis-cis-D13-31-3-oxo-C50-2-ACPs[c] + 1 PROTON[c] => 1 cis-cis-D13-31-3-hydroxyC50-2-ACPs[c] + 1 NADP[c]
- With common name(s):
- 1 NADPH[c] + 1 a cis,cis-delta13,31-3-oxo-C50:2-[acp][c] + 1 H+[c] => 1 a cis,cis-delta13,31-3-hydroxy C50:2-[acp][c] + 1 NADP+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_13083
- Source: orthology-esiliculosus
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
External links
"cis,cis-delta13,31-3-oxo-C50:2-[acyl-carrier protein] reductase" cannot be used as a page name in this wiki.
