Difference between revisions of "CPD-11409"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_8143 == * Synonym(s): == Reactions associated == * 2.4.1.223-RXN ** pantograph-esiliculosus == Pathways associated == * PWY-...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11409 CPD-11409] == * smiles: ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-]...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_8143 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11409 CPD-11409] ==
 +
* smiles:
 +
** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C(I)=C3))
 +
* common name:
 +
** tetraiodothyroacetate ether glucuronide
 +
* inchi key:
 +
** InChIKey=GYORPZQLVMNOGY-RUPWJETCSA-L
 +
* molecular weight:
 +
** 921.943   
 
* Synonym(s):
 
* Synonym(s):
 +
** tetraiodothyroacetic acid ether glucuronide
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[2.4.1.223-RXN]]
+
== Reaction(s) known to produce the compound ==
** [[pantograph]]-[[esiliculosus]]
+
* [[RXN-10616]]
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
* [[PWY-6558]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=2.4.1.223-RXN}}
+
* PUBCHEM:
{{#set: pathway associated=PWY-6558}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659237 90659237]
 +
{{#set: smiles=C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C(I)=C3))}}
 +
{{#set: common name=tetraiodothyroacetate ether glucuronide}}
 +
{{#set: inchi key=InChIKey=GYORPZQLVMNOGY-RUPWJETCSA-L}}
 +
{{#set: molecular weight=921.943    }}
 +
{{#set: common name=tetraiodothyroacetic acid ether glucuronide}}
 +
{{#set: produced by=RXN-10616}}

Latest revision as of 20:10, 21 March 2018

Metabolite CPD-11409

  • smiles:
    • C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C(I)=C3))
  • common name:
    • tetraiodothyroacetate ether glucuronide
  • inchi key:
    • InChIKey=GYORPZQLVMNOGY-RUPWJETCSA-L
  • molecular weight:
    • 921.943
  • Synonym(s):
    • tetraiodothyroacetic acid ether glucuronide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C(I)=C3))" cannot be used as a page name in this wiki.