Difference between revisions of "Tiso gene 8612"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11409 CPD-11409] == * smiles: ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-]...")
 
(Created page with "Category:Gene == Gene Tiso_gene_8612 == * right end position: ** 2657 * transcription direction: ** POSITIVE * left end position: ** 759 * centisome position: ** 7.534247...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11409 CPD-11409] ==
+
== Gene Tiso_gene_8612 ==
* smiles:
+
* right end position:
** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C(I)=C3))
+
** 2657
* inchi key:
+
* transcription direction:
** InChIKey=GYORPZQLVMNOGY-RUPWJETCSA-L
+
** POSITIVE
* common name:
+
* left end position:
** tetraiodothyroacetate ether glucuronide
+
** 759
* molecular weight:
+
* centisome position:
** 921.943    
+
** 7.534247    
 
* Synonym(s):
 
* Synonym(s):
** tetraiodothyroacetic acid ether glucuronide
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ARYL-ALCOHOL-DEHYDROGENASE-NADP+-RXN]]
* [[RXN-10616]]
+
** Source: [[annotation-in-silico_annotation]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[RXN0-5141]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=2657}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659237 90659237]
+
{{#set: transcription direction=POSITIVE}}
{{#set: smiles=C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C(I)=C3))}}
+
{{#set: left end position=759}}
{{#set: inchi key=InChIKey=GYORPZQLVMNOGY-RUPWJETCSA-L}}
+
{{#set: centisome position=7.534247   }}
{{#set: common name=tetraiodothyroacetate ether glucuronide}}
+
{{#set: reaction associated=ARYL-ALCOHOL-DEHYDROGENASE-NADP+-RXN|RXN0-5141}}
{{#set: molecular weight=921.943   }}
+
{{#set: common name=tetraiodothyroacetic acid ether glucuronide}}
+
{{#set: produced by=RXN-10616}}
+

Latest revision as of 21:10, 21 March 2018

Gene Tiso_gene_8612

  • right end position:
    • 2657
  • transcription direction:
    • POSITIVE
  • left end position:
    • 759
  • centisome position:
    • 7.534247
  • Synonym(s):

Reactions associated

Pathways associated

External links