Difference between revisions of "CPD-8990"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_6340 == * left end position: ** 66 * transcription direction: ** POSITIVE * right end position: ** 1464 * centisome position: ** 0.53610593...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8990 CPD-8990] == * smiles: ** CS(=O)CCC([N+])C(=O)[O-] * common name: ** L-methionine-(R)-...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8990 CPD-8990] == |
− | * | + | * smiles: |
− | ** | + | ** CS(=O)CCC([N+])C(=O)[O-] |
− | * | + | * common name: |
− | ** | + | ** L-methionine-(R)-S-oxide |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=QEFRNWWLZKMPFJ-ZXPFJRLXSA-N |
− | * | + | * molecular weight: |
− | ** | + | ** 165.207 |
* Synonym(s): | * Synonym(s): | ||
+ | ** L-methionine-R-sulfoxide | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[1.8.4.14-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11862103 11862103] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58773 58773] |
− | {{#set: | + | * BIGG : metsox_R__L |
− | {{#set: | + | {{#set: smiles=CS(=O)CCC([N+])C(=O)[O-]}} |
+ | {{#set: common name=L-methionine-(R)-S-oxide}} | ||
+ | {{#set: inchi key=InChIKey=QEFRNWWLZKMPFJ-ZXPFJRLXSA-N}} | ||
+ | {{#set: molecular weight=165.207 }} | ||
+ | {{#set: common name=L-methionine-R-sulfoxide}} | ||
+ | {{#set: consumed by=1.8.4.14-RXN}} |
Latest revision as of 21:10, 21 March 2018
Contents
Metabolite CPD-8990
- smiles:
- CS(=O)CCC([N+])C(=O)[O-]
- common name:
- L-methionine-(R)-S-oxide
- inchi key:
- InChIKey=QEFRNWWLZKMPFJ-ZXPFJRLXSA-N
- molecular weight:
- 165.207
- Synonym(s):
- L-methionine-R-sulfoxide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CS(=O)CCC([N+])C(=O)[O-" cannot be used as a page name in this wiki.