Difference between revisions of "CPD-8990"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Serines Serines] == * common name: ** serine * Synonym(s): ** (L) or (D)-serine == Reaction(s)...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8990 CPD-8990] == * smiles: ** CS(=O)CCC([N+])C(=O)[O-] * common name: ** L-methionine-(R)-...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Serines Serines] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8990 CPD-8990] ==
 +
* smiles:
 +
** CS(=O)CCC([N+])C(=O)[O-]
 
* common name:
 
* common name:
** serine
+
** L-methionine-(R)-S-oxide
 +
* inchi key:
 +
** InChIKey=QEFRNWWLZKMPFJ-ZXPFJRLXSA-N
 +
* molecular weight:
 +
** 165.207   
 
* Synonym(s):
 
* Synonym(s):
** (L) or (D)-serine
+
** L-methionine-R-sulfoxide
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[1.8.4.14-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PSERPHOSPHA-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=serine}}
+
* PUBCHEM:
{{#set: common name=(L) or (D)-serine}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11862103 11862103]
{{#set: produced by=PSERPHOSPHA-RXN}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58773 58773]
 +
* BIGG : metsox_R__L
 +
{{#set: smiles=CS(=O)CCC([N+])C(=O)[O-]}}
 +
{{#set: common name=L-methionine-(R)-S-oxide}}
 +
{{#set: inchi key=InChIKey=QEFRNWWLZKMPFJ-ZXPFJRLXSA-N}}
 +
{{#set: molecular weight=165.207    }}
 +
{{#set: common name=L-methionine-R-sulfoxide}}
 +
{{#set: consumed by=1.8.4.14-RXN}}

Latest revision as of 21:10, 21 March 2018

Metabolite CPD-8990

  • smiles:
    • CS(=O)CCC([N+])C(=O)[O-]
  • common name:
    • L-methionine-(R)-S-oxide
  • inchi key:
    • InChIKey=QEFRNWWLZKMPFJ-ZXPFJRLXSA-N
  • molecular weight:
    • 165.207
  • Synonym(s):
    • L-methionine-R-sulfoxide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CS(=O)CCC([N+])C(=O)[O-" cannot be used as a page name in this wiki.