Difference between revisions of "N-terminal-N-Ac-L-cysteine"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11409 CPD-11409] == * smiles: ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-]...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-N-Ac-L-cysteine N-terminal-N-Ac-L-cysteine] == * common name: ** an N-terminal N&alp...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11409 CPD-11409] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-N-Ac-L-cysteine N-terminal-N-Ac-L-cysteine] ==
* smiles:
+
** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C(I)=C3))
+
* inchi key:
+
** InChIKey=GYORPZQLVMNOGY-RUPWJETCSA-L
+
 
* common name:
 
* common name:
** tetraiodothyroacetate ether glucuronide
+
** an N-terminal Nα-acetyl-L-cysteinyl-[protein]
* molecular weight:
+
** 921.943   
+
 
* Synonym(s):
 
* Synonym(s):
** tetraiodothyroacetic acid ether glucuronide
+
** a [protein] N-terminal Nα-acetyl-L-cysteine
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10616]]
+
* [[RXN-17861]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an N-terminal Nα-acetyl-L-cysteinyl-[protein]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659237 90659237]
+
{{#set: common name=a [protein] N-terminal Nα-acetyl-L-cysteine}}
{{#set: smiles=C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C(I)=C3))}}
+
{{#set: produced by=RXN-17861}}
{{#set: inchi key=InChIKey=GYORPZQLVMNOGY-RUPWJETCSA-L}}
+
{{#set: common name=tetraiodothyroacetate ether glucuronide}}
+
{{#set: molecular weight=921.943    }}
+
{{#set: common name=tetraiodothyroacetic acid ether glucuronide}}
+
{{#set: produced by=RXN-10616}}
+

Latest revision as of 20:10, 21 March 2018

Metabolite N-terminal-N-Ac-L-cysteine

  • common name:
    • an N-terminal Nα-acetyl-L-cysteinyl-[protein]
  • Synonym(s):
    • a [protein] N-terminal Nα-acetyl-L-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an N-terminal Nα-acetyl-L-cysteinyl-[protein" cannot be used as a page name in this wiki.
"a [protein] N-terminal Nα-acetyl-L-cysteine" cannot be used as a page name in this wiki.