Difference between revisions of "CPD-695"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16615 RXN-16615] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxoacyl-synthase * ec num...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-695 CPD-695] == * smiles: ** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16615 RXN-16615] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-695 CPD-695] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
 
* common name:
 
* common name:
−
** 3-oxoacyl-synthase
+
** gibberellin A53
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41]
+
** InChIKey=CZEMYYICWZPENF-VOLTXKGXSA-L
 +
* molecular weight:
 +
** 346.422   
 
* Synonym(s):
 
* Synonym(s):
 +
** GA53
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN1F-167]]
−
** 1 [[PROTON]][c] '''+''' 1 [[3Z-dodec-3-enoyl-ACPs]][c] '''+''' 1 [[MALONYL-ACP]][c] '''=>''' 1 [[ACP]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[5Z-3-oxo-tetradec-5-enoyl-ACPs]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H+[c] '''+''' 1 a (3Z)-dodec-3-enoyl-[acp][c] '''+''' 1 a malonyl-[acp][c] '''=>''' 1 a holo-[acyl-carrier protein][c] '''+''' 1 CO2[c] '''+''' 1 a (5Z)-3-oxo-tetradec-5-enoyl-[acp][c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_5939]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
** EXPERIMENTAL_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-7664]], oleate biosynthesis IV (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7664 PWY-7664]
+
−
** '''10''' reactions found over '''14''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[experimental_annotation]]
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=3-oxoacyl-synthase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203620 25203620]
−
{{#set: ec number=EC-2.3.1.41}}
+
* HMDB : HMDB36895
−
{{#set: gene associated=Tiso_gene_5939}}
+
* CHEBI:
−
{{#set: in pathway=PWY-7664}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27433 27433]
−
{{#set: reconstruction category=annotation}}
+
* LIGAND-CPD:
−
{{#set: reconstruction tool=pathwaytools}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C06094 C06094]
−
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+
{{#set: smiles=C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
 +
{{#set: common name=gibberellin A53}}
 +
{{#set: inchi key=InChIKey=CZEMYYICWZPENF-VOLTXKGXSA-L}}
 +
{{#set: molecular weight=346.422    }}
 +
{{#set: common name=GA53}}
 +
{{#set: consumed by=RXN1F-167}}

Latest revision as of 20:10, 21 March 2018

Metabolite CPD-695

  • smiles:
    • C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
  • common name:
    • gibberellin A53
  • inchi key:
    • InChIKey=CZEMYYICWZPENF-VOLTXKGXSA-L
  • molecular weight:
    • 346.422
  • Synonym(s):
    • GA53

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-695&oldid=46498"