Difference between revisions of "RXN-9523"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19167 CPD-19167] == * smiles: ** CCCCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9523 RXN-9523] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxo-octanoyl-[acyl-carrier...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19167 CPD-19167] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9523 RXN-9523] ==
* smiles:
+
* direction:
** CCCCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=BUCIFQOXNYHEOO-YDGGZUKGSA-J
+
 
* common name:
 
* common name:
** 3-oxo-(7Z)-hexadecenoyl-CoA
+
** 3-oxo-octanoyl-[acyl-carrier protein] synthase
* molecular weight:
+
** 3-oxoacyl-synthase
** 1013.883   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41]
 
* Synonym(s):
 
* Synonym(s):
** 3-oxo-16:1-Δ7-CoA
 
** 3-oxo-7-cis-hexadecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-17782]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[Hexanoyl-ACPs]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[MALONYL-ACP]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[ACP]][c] '''+''' 1 [[3-Oxo-octanoyl-ACPs]][c]
* [[RXN-17781]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 a hexanoyl-[acyl-carrier-protein][c] '''+''' 1 H+[c] '''+''' 1 a malonyl-[acp][c] '''=>''' 1 CO2[c] '''+''' 1 a holo-[acyl-carrier protein][c] '''+''' 1 a 3-oxo-octanoyl-[acp][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_5939]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_15991]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_19302]]
 +
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_14485]]
 +
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971]
 +
** '''31''' reactions found over '''31''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-synechocystis]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[manual]]
 +
** Source: [[manual-primary_network]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: direction=LEFT-TO-RIGHT}}
{{#set: inchi key=InChIKey=BUCIFQOXNYHEOO-YDGGZUKGSA-J}}
+
{{#set: common name=3-oxo-octanoyl-[acyl-carrier protein] synthase}}
{{#set: common name=3-oxo-(7Z)-hexadecenoyl-CoA}}
+
{{#set: common name=3-oxoacyl-synthase}}
{{#set: molecular weight=1013.883    }}
+
{{#set: ec number=EC-2.3.1.41}}
{{#set: common name=3-oxo-16:1-Δ7-CoA|3-oxo-7-cis-hexadecenoyl-CoA}}
+
{{#set: gene associated=Tiso_gene_5939|Tiso_gene_15991|Tiso_gene_19302|Tiso_gene_14485}}
{{#set: consumed by=RXN-17782}}
+
{{#set: in pathway=PWY-5971}}
{{#set: produced by=RXN-17781}}
+
{{#set: reconstruction category=orthology|manual|annotation}}
 +
{{#set: reconstruction source=annotation-experimental_annotation|orthology-esiliculosus|annotation-in-silico_annotation|orthology-athaliana|orthology-synechocystis|manual-primary_network}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 21:10, 21 March 2018

Reaction RXN-9523

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-oxo-octanoyl-[acyl-carrier protein] synthase
    • 3-oxoacyl-synthase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5971, palmitate biosynthesis II (bacteria and plants): PWY-5971
    • 31 reactions found over 31 reactions in the full pathway

Reconstruction information

External links

"3-oxo-octanoyl-[acyl-carrier protein] synthase" cannot be used as a page name in this wiki.