Difference between revisions of "Tiso gene 3523"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19167 CPD-19167] == * smiles: ** CCCCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...")
(Created page with "Category:Gene == Gene Tiso_gene_3523 == * Synonym(s): == Reactions associated == * Reaction: CDPDIGLYSYN-RXN ** Source: orthology-esiliculosus * Reaction: RXN0-...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19167 CPD-19167] ==
+
== Gene Tiso_gene_3523 ==
−
* smiles:
+
−
** CCCCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
−
* inchi key:
+
−
** InChIKey=BUCIFQOXNYHEOO-YDGGZUKGSA-J
+
−
* common name:
+
−
** 3-oxo-(7Z)-hexadecenoyl-CoA
+
−
* molecular weight:
+
−
** 1013.883   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-oxo-16:1-Δ7-CoA
 
−
** 3-oxo-7-cis-hexadecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-17782]]
+
* Reaction: [[CDPDIGLYSYN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-esiliculosus]]
−
* [[RXN-17781]]
+
* Reaction: [[RXN0-5515]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-7817]]
 +
* [[PWY-5667]]
 +
* [[PWY-5981]]
 +
* [[PWY0-1319]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction associated=CDPDIGLYSYN-RXN|RXN0-5515}}
−
{{#set: inchi key=InChIKey=BUCIFQOXNYHEOO-YDGGZUKGSA-J}}
+
{{#set: pathway associated=PWY-7817|PWY-5667|PWY-5981|PWY0-1319}}
−
{{#set: common name=3-oxo-(7Z)-hexadecenoyl-CoA}}
+
−
{{#set: molecular weight=1013.883    }}
+
−
{{#set: common name=3-oxo-16:1-Δ7-CoA|3-oxo-7-cis-hexadecenoyl-CoA}}
+
−
{{#set: consumed by=RXN-17782}}
+
−
{{#set: produced by=RXN-17781}}
+

Latest revision as of 20:10, 21 March 2018

Gene Tiso_gene_3523

  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_3523&oldid=46520"