Difference between revisions of "Tiso gene 10542"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPATE SINAPATE] == * smiles: ** COC1(C=C(C=C(OC)C(O)=1)C=CC([O-])=O) * inchi key: ** InChIKe...")
(Created page with "Category:Gene == Gene Tiso_gene_10542 == * right end position: ** 6459 * transcription direction: ** POSITIVE * left end position: ** 3509 * centisome position: ** 41.5168...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPATE SINAPATE] ==
+
== Gene Tiso_gene_10542 ==
−
* smiles:
+
* right end position:
−
** COC1(C=C(C=C(OC)C(O)=1)C=CC([O-])=O)
+
** 6459
−
* inchi key:
+
* transcription direction:
−
** InChIKey=PCMORTLOPMLEFB-ONEGZZNKSA-M
+
** POSITIVE
−
* common name:
+
* left end position:
−
** sinapate
+
** 3509
−
* molecular weight:
+
* centisome position:
−
** 223.205    
+
** 41.5168    
 
* Synonym(s):
 
* Synonym(s):
−
** 3,5-dimethoxy-4-hydroxycinnamate
 
−
** sinapinate
 
−
** sinapinic acid
 
−
** sinapic acid
 
−
** 3,5-dimethoxy-4-hydroxycinnamic acid
 
−
** 4-hydroxy-3,5-dimethoxycinnamate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-10919]]
+
* Reaction: [[PROTEIN-KINASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-3422]]
+
*** Assignment: automated-name-match
−
* [[RXN-8014]]
+
== Pathways associated ==
−
== Reaction(s) of unknown directionality ==
+
 
== External links  ==
 
== External links  ==
−
* NCI:
+
{{#set: right end position=6459}}
−
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=59261 59261]
+
{{#set: transcription direction=POSITIVE}}
−
* CAS : 530-59-6
+
{{#set: left end position=3509}}
−
* PUBCHEM:
+
{{#set: centisome position=41.5168   }}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54710960 54710960]
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
−
* HMDB : HMDB32616
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00482 C00482]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.4573878.html 4573878]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30023 30023]
+
−
{{#set: smiles=COC1(C=C(C=C(OC)C(O)=1)C=CC([O-])=O)}}
+
−
{{#set: inchi key=InChIKey=PCMORTLOPMLEFB-ONEGZZNKSA-M}}
+
−
{{#set: common name=sinapate}}
+
−
{{#set: molecular weight=223.205   }}
+
−
{{#set: common name=3,5-dimethoxy-4-hydroxycinnamate|sinapinate|sinapinic acid|sinapic acid|3,5-dimethoxy-4-hydroxycinnamic acid|4-hydroxy-3,5-dimethoxycinnamate}}
+
−
{{#set: consumed by=RXN-10919}}
+
−
{{#set: produced by=RXN-3422|RXN-8014}}
+

Latest revision as of 20:10, 21 March 2018

Gene Tiso_gene_10542

  • right end position:
    • 6459
  • transcription direction:
    • POSITIVE
  • left end position:
    • 3509
  • centisome position:
    • 41.5168
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_10542&oldid=46523"