Difference between revisions of "CPD-10809"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12611 RXN-12611] == * direction: ** LEFT-TO-RIGHT * common name: ** thiamin phosphate synthase...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10809 CPD-10809] == * smiles: ** C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-] *...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12611 RXN-12611] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10809 CPD-10809] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-]
 
* common name:
 
* common name:
−
** thiamin phosphate synthase
+
** 2,5-diamino-6-(5-phospho-D-ribitylamino)pyrimidin-4(3H)-one
−
** ORF
+
* inchi key:
−
** thiamine_monophosphate_synthase
+
** InChIKey=ACIVVGBVOVHFPQ-RPDRRWSUSA-L
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.5.1.3 EC-2.5.1.3]
+
** 353.228   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-10058]]
−
** 2 [[PROTON]][c] '''+''' 1 [[AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP]][c] '''+''' 1 [[CPD-13575]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[THIAMINE-P]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 2 H+[c] '''+''' 1 4-amino-2-methyl-5-(diphosphomethyl)pyrimidine[c] '''+''' 1 2-[(2R,5Z)-2-carboxy-4-methylthiazol-5(2H)-ylidene]ethyl phosphate[c] '''=>''' 1 diphosphate[c] '''+''' 1 CO2[c] '''+''' 1 thiamine phosphate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_2160]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_10320]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_2159]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-6894]], thiamine diphosphate biosynthesis I (E. coli): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6894 PWY-6894]
+
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=thiamin phosphate synthase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45480553 45480553]
−
{{#set: common name=ORF}}
+
* CHEBI:
−
{{#set: common name=thiamine_monophosphate_synthase}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58890 58890]
−
{{#set: ec number=EC-2.5.1.3}}
+
{{#set: smiles=C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-]}}
−
{{#set: gene associated=Tiso_gene_2160|Tiso_gene_10320|Tiso_gene_2159}}
+
{{#set: common name=2,5-diamino-6-(5-phospho-D-ribitylamino)pyrimidin-4(3H)-one}}
−
{{#set: in pathway=PWY-6894}}
+
{{#set: inchi key=InChIKey=ACIVVGBVOVHFPQ-RPDRRWSUSA-L}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: molecular weight=353.228    }}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate}}
−
{{#set: reconstruction source=in-silico_annotation}}
+
{{#set: consumed by=RXN-10058}}

Latest revision as of 20:10, 21 March 2018

Metabolite CPD-10809

  • smiles:
    • C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-]
  • common name:
    • 2,5-diamino-6-(5-phospho-D-ribitylamino)pyrimidin-4(3H)-one
  • inchi key:
    • InChIKey=ACIVVGBVOVHFPQ-RPDRRWSUSA-L
  • molecular weight:
    • 353.228
  • Synonym(s):
    • 2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-10809&oldid=46542"