Difference between revisions of "RXN-12611"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-PROLINE D-PROLINE] == * smiles: ** C1([N+]C(CC1)C(=O)[O-]) * inchi key: ** InChIKey=ONIBWKKTO...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12611 RXN-12611] == * direction: ** LEFT-TO-RIGHT * common name: ** thiamin phosphate synthase...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-PROLINE D-PROLINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12611 RXN-12611] ==
* smiles:
+
* direction:
** C1([N+]C(CC1)C(=O)[O-])
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=ONIBWKKTOPOVIA-SCSAIBSYSA-N
+
 
* common name:
 
* common name:
** D-proline
+
** thiamin phosphate synthase
* molecular weight:
+
** ORF
** 115.132   
+
** thiamine_monophosphate_synthase
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.5.1.3 EC-2.5.1.3]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 1 [[AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP]][c] '''+''' 1 [[CPD-13575]][c] '''+''' 2 [[PROTON]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[THIAMINE-P]][c] '''+''' 1 [[PPI]][c]
* [[PROLINE-RACEMASE-RXN]]
+
* With common name(s):
 +
** 1 4-amino-2-methyl-5-(diphosphomethyl)pyrimidine[c] '''+''' 1 2-[(2R,5Z)-2-carboxy-4-methylthiazol-5(2H)-ylidene]ethyl phosphate[c] '''+''' 2 H+[c] '''=>''' 1 CO2[c] '''+''' 1 thiamine phosphate[c] '''+''' 1 diphosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_2159]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_2160]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_10320]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6894]], thiamine diphosphate biosynthesis I (E. coli): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6894 PWY-6894]
 +
** '''1''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* CAS : 344-25-2
+
{{#set: direction=LEFT-TO-RIGHT}}
* PUBCHEM:
+
{{#set: common name=thiamin phosphate synthase}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971012 6971012]
+
{{#set: common name=ORF}}
* HMDB : HMDB03411
+
{{#set: common name=thiamine_monophosphate_synthase}}
* LIGAND-CPD:
+
{{#set: ec number=EC-2.5.1.3}}
** [http://www.genome.jp/dbget-bin/www_bget?C00763 C00763]
+
{{#set: gene associated=Tiso_gene_2159|Tiso_gene_2160|Tiso_gene_10320}}
* CHEBI:
+
{{#set: in pathway=PWY-6894}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57726 57726]
+
{{#set: reconstruction category=annotation}}
* METABOLIGHTS : MTBLC57726
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
{{#set: smiles=C1([N+]C(CC1)C(=O)[O-])}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: inchi key=InChIKey=ONIBWKKTOPOVIA-SCSAIBSYSA-N}}
+
{{#set: common name=D-proline}}
+
{{#set: molecular weight=115.132    }}
+
{{#set: reversible reaction associated=PROLINE-RACEMASE-RXN}}
+

Latest revision as of 21:10, 21 March 2018

Reaction RXN-12611

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • thiamin phosphate synthase
    • ORF
    • thiamine_monophosphate_synthase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6894, thiamine diphosphate biosynthesis I (E. coli): PWY-6894
    • 1 reactions found over 2 reactions in the full pathway

Reconstruction information

External links