Difference between revisions of "MANNOSE-1P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXINE-5P PYRIDOXINE-5P] == * smiles: ** CC1(=NC=C(COP([O-])(=O)[O-])C(=C(O)1)CO) * common...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNOSE-1P MANNOSE-1P] == * smiles: ** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * common name:...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNOSE-1P MANNOSE-1P] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) |
* common name: | * common name: | ||
| − | ** | + | ** α-D-mannose 1-phosphate |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=HXXFSFRBOHSIMQ-RWOPYEJCSA-L |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 258.121 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** mannose-1-phosphate |
| − | ** | + | ** D-mannose-1-phosphate |
| − | ** | + | ** mannose-1-P |
| − | + | ** α-D-mannopyranose 1-phosphate | |
| − | + | ||
| − | ** | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.7.7.13-RXN]] |
| − | * [[ | + | * [[GAMPG]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[MANNPGUANYLTRANGDP-RXN]] | ||
| + | * [[PHOSMANMUT-RXN]] | ||
== External links == | == External links == | ||
| − | * CAS : | + | * CAS : 27251-84-9 |
| − | + | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245607 25245607] |
| − | * HMDB : | + | * HMDB : HMDB06330 |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00636 C00636] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58409 58409] |
| − | * | + | * BIGG : man1p |
| − | {{#set: smiles | + | {{#set: smiles=C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)}} |
| − | {{#set: common name= | + | {{#set: common name=α-D-mannose 1-phosphate}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=HXXFSFRBOHSIMQ-RWOPYEJCSA-L}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=258.121 }} |
| − | {{#set: common name= | + | {{#set: common name=mannose-1-phosphate|D-mannose-1-phosphate|mannose-1-P|α-D-mannopyranose 1-phosphate}} |
| − | {{#set: consumed by= | + | {{#set: consumed by=2.7.7.13-RXN|GAMPG}} |
| − | {{#set: | + | {{#set: reversible reaction associated=MANNPGUANYLTRANGDP-RXN|PHOSMANMUT-RXN}} |
Latest revision as of 21:10, 21 March 2018
Contents
Metabolite MANNOSE-1P
- smiles:
- C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)
- common name:
- α-D-mannose 1-phosphate
- inchi key:
- InChIKey=HXXFSFRBOHSIMQ-RWOPYEJCSA-L
- molecular weight:
- 258.121
- Synonym(s):
- mannose-1-phosphate
- D-mannose-1-phosphate
- mannose-1-P
- α-D-mannopyranose 1-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)" cannot be used as a page name in this wiki.
