Difference between revisions of "3-DEHYDROQUINATE-DEHYDRATASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DETHIOBIOTIN DETHIOBIOTIN] == * smiles: ** CC1(NC(=O)NC1CCCCCC(=O)[O-]) * inchi key: ** InChIKe...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3-DEHYDROQUINATE-DEHYDRATASE-RXN 3-DEHYDROQUINATE-DEHYDRATASE-RXN] == * direction: ** REVERSIBLE *...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DETHIOBIOTIN DETHIOBIOTIN] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=3-DEHYDROQUINATE-DEHYDRATASE-RXN 3-DEHYDROQUINATE-DEHYDRATASE-RXN] ==
−
* smiles:
+
* direction:
−
** CC1(NC(=O)NC1CCCCCC(=O)[O-])
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=AUTOLBMXDDTRRT-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** dethiobiotin
+
** pentafunctional_protein
−
* molecular weight:
+
* ec number:
−
** 213.256   
+
** [http://enzyme.expasy.org/EC/4.2.1.10 EC-4.2.1.10]
 
* Synonym(s):
 
* Synonym(s):
−
** desthiobiotin
 
−
** DTB
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[2.8.1.6-RXN]]
+
* With identifiers:
−
* [[RXN-17472]]
+
** 1 [[DEHYDROQUINATE]][c] '''<=>''' 1 [[3-DEHYDRO-SHIKIMATE]][c] '''+''' 1 [[WATER]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
* [[DETHIOBIOTIN-SYN-RXN]]
+
** 1 3-dehydroquinate[c] '''<=>''' 1 3-dehydroshikimate[c] '''+''' 1 H2O[c]
−
== Reaction(s) of unknown directionality ==
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_14718]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_5752]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_5753]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_5619]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_8720]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-6707]], gallate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6707 PWY-6707]
 +
** '''1''' reactions found over '''3''' reactions in the full pathway
 +
* [[PWY-6416]], quinate degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6416 PWY-6416]
 +
** '''2''' reactions found over '''3''' reactions in the full pathway
 +
* [[QUINATEDEG-PWY]], quinate degradation I: [http://metacyc.org/META/NEW-IMAGE?object=QUINATEDEG-PWY QUINATEDEG-PWY]
 +
** '''1''' reactions found over '''3''' reactions in the full pathway
 +
* [[PWY-6163]], chorismate biosynthesis from 3-dehydroquinate: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6163 PWY-6163]
 +
** '''6''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[manual]]
 +
** Source: [[manual-primary_network]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 533-48-2
+
* RHEA:
−
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21096 21096]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244917 25244917]
+
* LIGAND-RXN:
−
* HMDB : HMDB03581
+
** [http://www.genome.jp/dbget-bin/www_bget?R03084 R03084]
−
* LIGAND-CPD:
+
* UNIPROT:
−
** [http://www.genome.jp/dbget-bin/www_bget?C01909 C01909]
+
** [http://www.uniprot.org/uniprot/P05195 P05195]
−
* CHEBI:
+
** [http://www.uniprot.org/uniprot/P46380 P46380]
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57861 57861]
+
** [http://www.uniprot.org/uniprot/Q9CF39 Q9CF39]
−
* BIGG : dtbt
+
** [http://www.uniprot.org/uniprot/P07547 P07547]
−
{{#set: smiles=CC1(NC(=O)NC1CCCCCC(=O)[O-])}}
+
** [http://www.uniprot.org/uniprot/P08566 P08566]
−
{{#set: inchi key=InChIKey=AUTOLBMXDDTRRT-UHFFFAOYSA-M}}
+
** [http://www.uniprot.org/uniprot/P43878 P43878]
−
{{#set: common name=dethiobiotin}}
+
** [http://www.uniprot.org/uniprot/P05194 P05194]
−
{{#set: molecular weight=213.256    }}
+
** [http://www.uniprot.org/uniprot/Q58849 Q58849]
−
{{#set: common name=desthiobiotin|DTB}}
+
** [http://www.uniprot.org/uniprot/P0A4Z6 P0A4Z6]
−
{{#set: consumed by=2.8.1.6-RXN|RXN-17472}}
+
** [http://www.uniprot.org/uniprot/Q9PJ53 Q9PJ53]
−
{{#set: produced by=DETHIOBIOTIN-SYN-RXN}}
+
** [http://www.uniprot.org/uniprot/P05147 P05147]
 +
** [http://www.uniprot.org/uniprot/P24670 P24670]
 +
** [http://www.uniprot.org/uniprot/P35146 P35146]
 +
** [http://www.uniprot.org/uniprot/Q42947 Q42947]
 +
** [http://www.uniprot.org/uniprot/Q48255 Q48255]
 +
** [http://www.uniprot.org/uniprot/P73367 P73367]
 +
** [http://www.uniprot.org/uniprot/O65917 O65917]
 +
{{#set: direction=REVERSIBLE}}
 +
{{#set: common name=pentafunctional_protein}}
 +
{{#set: ec number=EC-4.2.1.10}}
 +
{{#set: gene associated=Tiso_gene_14718|Tiso_gene_5752|Tiso_gene_5753|Tiso_gene_5619|Tiso_gene_8720}}
 +
{{#set: in pathway=PWY-6707|PWY-6416|QUINATEDEG-PWY|PWY-6163}}
 +
{{#set: reconstruction category=orthology|manual|annotation}}
 +
{{#set: reconstruction source=orthology-athaliana|annotation-in-silico_annotation|manual-primary_network|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 21:10, 21 March 2018

Reaction 3-DEHYDROQUINATE-DEHYDRATASE-RXN

  • direction:
    • REVERSIBLE
  • common name:
    • pentafunctional_protein
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6707, gallate biosynthesis: PWY-6707
    • 1 reactions found over 3 reactions in the full pathway
  • PWY-6416, quinate degradation II: PWY-6416
    • 2 reactions found over 3 reactions in the full pathway
  • QUINATEDEG-PWY, quinate degradation I: QUINATEDEG-PWY
    • 1 reactions found over 3 reactions in the full pathway
  • PWY-6163, chorismate biosynthesis from 3-dehydroquinate: PWY-6163
    • 6 reactions found over 6 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=3-DEHYDROQUINATE-DEHYDRATASE-RXN&oldid=46574"