Difference between revisions of "HOP-2229-ENE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE 3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE] == * smiles: ** C[N+](...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOP-2229-ENE HOP-2229-ENE] == * smiles: ** C=C(C)C5(CCC4(C)([CH](CCC2(C)([CH](CC[CH]1(C3(C)(CCC...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOP-2229-ENE HOP-2229-ENE] == |
* smiles: | * smiles: | ||
− | ** C | + | ** C=C(C)C5(CCC4(C)([CH](CCC2(C)([CH](CC[CH]1(C3(C)(CCCC(C)(C)[CH](CCC(C)12)3)))4))5)) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** hop-22(29)-ene |
+ | * inchi key: | ||
+ | ** InChIKey=HHXYJYBYNZMZKX-PYQRSULMSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 410.725 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** diploptene |
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[5.4.99.17-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=92155 92155] |
− | * | + | * CHEMSPIDER: |
− | {{#set: smiles=C | + | ** [http://www.chemspider.com/Chemical-Structure.83200.html 83200] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=4648 4648] |
− | {{#set: molecular weight= | + | * LIGAND-CPD: |
− | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06310 C06310] |
− | {{#set: | + | {{#set: smiles=C=C(C)C5(CCC4(C)([CH](CCC2(C)([CH](CC[CH]1(C3(C)(CCCC(C)(C)[CH](CCC(C)12)3)))4))5))}} |
+ | {{#set: common name=hop-22(29)-ene}} | ||
+ | {{#set: inchi key=InChIKey=HHXYJYBYNZMZKX-PYQRSULMSA-N}} | ||
+ | {{#set: molecular weight=410.725 }} | ||
+ | {{#set: common name=diploptene}} | ||
+ | {{#set: produced by=5.4.99.17-RXN}} |
Latest revision as of 21:11, 21 March 2018
Contents
Metabolite HOP-2229-ENE
- smiles:
- C=C(C)C5(CCC4(C)([CH](CCC2(C)([CH](CC[CH]1(C3(C)(CCCC(C)(C)[CH](CCC(C)12)3)))4))5))
- common name:
- hop-22(29)-ene
- inchi key:
- InChIKey=HHXYJYBYNZMZKX-PYQRSULMSA-N
- molecular weight:
- 410.725
- Synonym(s):
- diploptene
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C(C)C5(CCC4(C)([CH](CCC2(C)([CH](CC[CH]1(C3(C)(CCCC(C)(C)[CH](CCC(C)12)3)))4))5))" cannot be used as a page name in this wiki.