Difference between revisions of "CPD-3801"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_4174 == * left end position: ** 1026 * transcription direction: ** POSITIVE * right end position: ** 1474 * centisome position: ** 5.325996...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3801 CPD-3801] == * smiles: ** C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O * commo...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3801 CPD-3801] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O |
| − | * | + | * common name: |
| − | ** | + | ** melibionate |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=MUUBPEHTAPZMCA-RQPDCMAESA-M |
| − | * | + | * molecular weight: |
| − | ** | + | ** 357.291 |
* Synonym(s): | * Synonym(s): | ||
| + | ** melibionic acid | ||
| + | ** 6-O-α-D-galactopyranosyl-D-gluconic acid | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-17754]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202771 25202771] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75299 75299] |
| − | {{#set: | + | {{#set: smiles=C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O}} |
| − | {{#set: | + | {{#set: common name=melibionate}} |
| + | {{#set: inchi key=InChIKey=MUUBPEHTAPZMCA-RQPDCMAESA-M}} | ||
| + | {{#set: molecular weight=357.291 }} | ||
| + | {{#set: common name=melibionic acid|6-O-α-D-galactopyranosyl-D-gluconic acid}} | ||
| + | {{#set: consumed by=RXN-17754}} | ||
Latest revision as of 20:11, 21 March 2018
Contents
Metabolite CPD-3801
- smiles:
- C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O
- common name:
- melibionate
- inchi key:
- InChIKey=MUUBPEHTAPZMCA-RQPDCMAESA-M
- molecular weight:
- 357.291
- Synonym(s):
- melibionic acid
- 6-O-α-D-galactopyranosyl-D-gluconic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O" cannot be used as a page name in this wiki.
