Difference between revisions of "CPD-703"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Tubulin-acetyl-L-lysine Tubulin-acetyl-L-lysine] == * common name: ** an [α-tubulin]-N6-a...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-703 CPD-703] == * smiles: ** C(=O)C1(C=CC(=CC=1)[N+]([O-])=O) * common name: ** 4-nitrobenz...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Tubulin-acetyl-L-lysine Tubulin-acetyl-L-lysine] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-703 CPD-703] ==
 +
* smiles:
 +
** C(=O)C1(C=CC(=CC=1)[N+]([O-])=O)
 
* common name:
 
* common name:
** an [α-tubulin]-N6-acetyl-L-lysine
+
** 4-nitrobenzaldehyde
 +
* inchi key:
 +
** InChIKey=BXRFQSNOROATLV-UHFFFAOYSA-N
 +
* molecular weight:
 +
** 151.121   
 
* Synonym(s):
 
* Synonym(s):
 +
** 4NBZ
 +
** p-nitrobenzaldehyde
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN0-5141]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[TUBULIN-N-ACETYLTRANSFERASE-RXN]]
 
 
== External links  ==
 
== External links  ==
{{#set: common name=an [α-tubulin]-N6-acetyl-L-lysine}}
+
* CAS : 555-16-8
{{#set: consumed or produced by=TUBULIN-N-ACETYLTRANSFERASE-RXN}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=541 541]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.526.html 526]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=66926 66926]
 +
* NCI:
 +
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=6103 6103]
 +
{{#set: smiles=C(=O)C1(C=CC(=CC=1)[N+]([O-])=O)}}
 +
{{#set: common name=4-nitrobenzaldehyde}}
 +
{{#set: inchi key=InChIKey=BXRFQSNOROATLV-UHFFFAOYSA-N}}
 +
{{#set: molecular weight=151.121    }}
 +
{{#set: common name=4NBZ|p-nitrobenzaldehyde}}
 +
{{#set: consumed by=RXN0-5141}}

Latest revision as of 20:11, 21 March 2018

Metabolite CPD-703

  • smiles:
    • C(=O)C1(C=CC(=CC=1)[N+]([O-])=O)
  • common name:
    • 4-nitrobenzaldehyde
  • inchi key:
    • InChIKey=BXRFQSNOROATLV-UHFFFAOYSA-N
  • molecular weight:
    • 151.121
  • Synonym(s):
    • 4NBZ
    • p-nitrobenzaldehyde

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)C1(C=CC(=CC=1)[N+]([O-])=O)" cannot be used as a page name in this wiki.