Difference between revisions of "Tiso gene 16542"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4186 CPD-4186] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2([CH](CC1)C3(C)([CH](CC=2)CC(O)...")
 
(Created page with "Category:Gene == Gene Tiso_gene_16542 == * right end position: ** 3520 * transcription direction: ** POSITIVE * left end position: ** 21 * centisome position: ** 0.4889406...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4186 CPD-4186] ==
+
== Gene Tiso_gene_16542 ==
−
* smiles:
+
* right end position:
−
** CC(C)CCCC([CH]4(C1(C)([CH](C2([CH](CC1)C3(C)([CH](CC=2)CC(O)CC3)))CC4)))C
+
** 3520
−
* inchi key:
+
* transcription direction:
−
** InChIKey=IZVFFXVYBHFIHY-SKCNUYALSA-N
+
** POSITIVE
−
* common name:
+
* left end position:
−
** lathosterol
+
** 21
−
* molecular weight:
+
* centisome position:
−
** 386.66    
+
** 0.48894063    
 
* Synonym(s):
 
* Synonym(s):
−
** 5α-cholest-7-en-3β-ol
 
−
** α-cholest-7-en-3β-ol
 
−
** cholesta-7-enol
 
−
** Δ7-cholesten-3-β-ol
 
−
** γ-cholesterol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[1.14.21.6-RXN]]
+
* Reaction: [[ADENYLATECYC-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* CAS : 80-99-9
+
{{#set: right end position=3520}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=65728 65728]
+
{{#set: left end position=21}}
−
* CHEBI:
+
{{#set: centisome position=0.48894063   }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17168 17168]
+
{{#set: reaction associated=ADENYLATECYC-RXN}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C01189 C01189]
+
−
* HMDB : HMDB01170
+
−
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2([CH](CC1)C3(C)([CH](CC=2)CC(O)CC3)))CC4)))C}}
+
−
{{#set: inchi key=InChIKey=IZVFFXVYBHFIHY-SKCNUYALSA-N}}
+
−
{{#set: common name=lathosterol}}
+
−
{{#set: molecular weight=386.66   }}
+
−
{{#set: common name=5α-cholest-7-en-3β-ol|α-cholest-7-en-3β-ol|cholesta-7-enol|Δ7-cholesten-3-β-ol|γ-cholesterol}}
+
−
{{#set: consumed by=1.14.21.6-RXN}}
+

Latest revision as of 20:11, 21 March 2018

Gene Tiso_gene_16542

  • right end position:
    • 3520
  • transcription direction:
    • POSITIVE
  • left end position:
    • 21
  • centisome position:
    • 0.48894063
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_16542&oldid=46668"