Difference between revisions of "CPD-6972"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_9140 == * left end position: ** 6694 * transcription direction: ** POSITIVE * right end position: ** 8924 * centisome position: ** 69.94775...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6972 CPD-6972] == * smiles: ** CC(COP([O-])(=O)OP([O-])(=O)OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6972 CPD-6972] == |
− | * | + | * smiles: |
− | ** | + | ** CC(COP([O-])(=O)OP([O-])(=O)OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)N)))O3)O)OP([O-])(=O)[O-]))(C)C(C(NCCC(NCCSC(CCC(C4(C=CC=CC(C([O-])=O)=4))=O)=O)=O)=O)O |
− | * | + | * common name: |
− | ** | + | ** 4-(2'-carboxyphenyl)-4-oxobutyryl-CoA |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=KVAQAPQXOXTRAE-UHFFFAOYSA-I |
− | * | + | * molecular weight: |
− | ** | + | ** 966.676 |
* Synonym(s): | * Synonym(s): | ||
+ | ** succinylbenzoyl-CoA | ||
+ | ** 2-succinylbenzoyl-CoA | ||
+ | ** 2-(3'-carboxypropionyl)benzoyl-CoA | ||
+ | ** o-succinylbenzoyl-CoA | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[NAPHTHOATE-SYN-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245100 25245100] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15509 15509] |
− | {{#set: | + | * BIGG : sbzcoa |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C03160 C03160] | ||
+ | {{#set: smiles=CC(COP([O-])(=O)OP([O-])(=O)OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)N)))O3)O)OP([O-])(=O)[O-]))(C)C(C(NCCC(NCCSC(CCC(C4(C=CC=CC(C([O-])=O)=4))=O)=O)=O)=O)O}} | ||
+ | {{#set: common name=4-(2'-carboxyphenyl)-4-oxobutyryl-CoA}} | ||
+ | {{#set: inchi key=InChIKey=KVAQAPQXOXTRAE-UHFFFAOYSA-I}} | ||
+ | {{#set: molecular weight=966.676 }} | ||
+ | {{#set: common name=succinylbenzoyl-CoA|2-succinylbenzoyl-CoA|2-(3'-carboxypropionyl)benzoyl-CoA|o-succinylbenzoyl-CoA}} | ||
+ | {{#set: consumed by=NAPHTHOATE-SYN-RXN}} |
Latest revision as of 20:11, 21 March 2018
Contents
Metabolite CPD-6972
- smiles:
- CC(COP([O-])(=O)OP([O-])(=O)OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)N)))O3)O)OP([O-])(=O)[O-]))(C)C(C(NCCC(NCCSC(CCC(C4(C=CC=CC(C([O-])=O)=4))=O)=O)=O)=O)O
- common name:
- 4-(2'-carboxyphenyl)-4-oxobutyryl-CoA
- inchi key:
- InChIKey=KVAQAPQXOXTRAE-UHFFFAOYSA-I
- molecular weight:
- 966.676
- Synonym(s):
- succinylbenzoyl-CoA
- 2-succinylbenzoyl-CoA
- 2-(3'-carboxypropionyl)benzoyl-CoA
- o-succinylbenzoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(COP([O-])(=O)OP([O-])(=O)OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)N)))O3)O)OP([O-])(=O)[O-]))(C)C(C(NCCC(NCCSC(CCC(C4(C=CC=CC(C([O-])=O)=4))=O)=O)=O)=O)O" cannot be used as a page name in this wiki.