Difference between revisions of "CPD-11641"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15007 RXN-15007] == * direction: ** REVERSIBLE * common name: ** acetylornithine_aminotransfera...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11641 CPD-11641] == * smiles: ** CC3(C2(C=CC(OC1(OC(CO)C(O)C(O)C(O)1))=CC=2OC(=O)C=3)) * co...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15007 RXN-15007] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11641 CPD-11641] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CC3(C2(C=CC(OC1(OC(CO)C(O)C(O)C(O)1))=CC=2OC(=O)C=3))
 
* common name:
 
* common name:
−
** acetylornithine_aminotransferase
+
** 4-methylumbelliferyl glucoside
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.6.1.11 EC-2.6.1.11]
+
** InChIKey=YUDPTGPSBJVHCN-YMILTQATSA-N
 +
* molecular weight:
 +
** 338.313   
 
* Synonym(s):
 
* Synonym(s):
 +
** 4-MU-glucoside
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-10769]]
−
** 1 [[LysW-L-ornithine]][c] '''+''' 1 [[2-KETOGLUTARATE]][c] '''<=>''' 1 [[GLT]][c] '''+''' 1 [[LysW-L-glutamate-5-semialdehyde]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 an [L-2-aminoadipate carrier protein]-L-ornithine[c] '''+''' 1 2-oxoglutarate[c] '''<=>''' 1 L-glutamate[c] '''+''' 1 an [L-2-aminoadipate carrier protein]-L-glutamate 5-semialdehyde[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_11231]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-7400]], L-arginine biosynthesis IV (archaebacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7400 PWY-7400]
+
−
** '''7''' reactions found over '''9''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* DRUGBANK : DB02639
−
{{#set: common name=acetylornithine_aminotransferase}}
+
* PUBCHEM:
−
{{#set: ec number=EC-2.6.1.11}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=2733779 2733779]
−
{{#set: gene associated=Tiso_gene_11231}}
+
* CHEMSPIDER:
−
{{#set: in pathway=PWY-7400}}
+
** [http://www.chemspider.com/Chemical-Structure.2015550.html 2015550]
−
{{#set: reconstruction category=orthology}}
+
* CHEBI:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=91117 91117]
−
{{#set: reconstruction source=esiliculosus}}
+
{{#set: smiles=CC3(C2(C=CC(OC1(OC(CO)C(O)C(O)C(O)1))=CC=2OC(=O)C=3))}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: common name=4-methylumbelliferyl glucoside}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: inchi key=InChIKey=YUDPTGPSBJVHCN-YMILTQATSA-N}}
−
{{#set: reconstruction source=in-silico_annotation}}
+
{{#set: molecular weight=338.313    }}
 +
{{#set: common name=4-MU-glucoside}}
 +
{{#set: consumed by=RXN-10769}}

Latest revision as of 20:11, 21 March 2018

Metabolite CPD-11641

  • smiles:
    • CC3(C2(C=CC(OC1(OC(CO)C(O)C(O)C(O)1))=CC=2OC(=O)C=3))
  • common name:
    • 4-methylumbelliferyl glucoside
  • inchi key:
    • InChIKey=YUDPTGPSBJVHCN-YMILTQATSA-N
  • molecular weight:
    • 338.313
  • Synonym(s):
    • 4-MU-glucoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-11641&oldid=46690"