Difference between revisions of "CPD-7025"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_4015 == * Synonym(s): == Reactions associated == * NODOx ** pantograph-creinhardtii * NODOy ** pantograph-creinhardt...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7025 CPD-7025] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C * common name:...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_4015 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7025 CPD-7025] ==
 +
* smiles:
 +
** CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C
 +
* common name:
 +
** phytyl monophosphate
 +
* inchi key:
 +
** InChIKey=YRXRHZOKDFCXIB-PYDDKJGSSA-L
 +
* molecular weight:
 +
** 374.499   
 
* Synonym(s):
 
* Synonym(s):
 +
** phytolmonophosphate
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[NODOx]]
+
== Reaction(s) known to produce the compound ==
** [[pantograph]]-[[creinhardtii]]
+
* [[RXN-7683]]
* [[NODOy]]
+
== Reaction(s) of unknown directionality ==
** [[pantograph]]-[[creinhardtii]]
+
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=NODOx|NODOy}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245113 25245113]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75483 75483]
 +
{{#set: smiles=CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C}}
 +
{{#set: common name=phytyl monophosphate}}
 +
{{#set: inchi key=InChIKey=YRXRHZOKDFCXIB-PYDDKJGSSA-L}}
 +
{{#set: molecular weight=374.499    }}
 +
{{#set: common name=phytolmonophosphate}}
 +
{{#set: produced by=RXN-7683}}

Latest revision as of 20:11, 21 March 2018

Metabolite CPD-7025

  • smiles:
    • CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C
  • common name:
    • phytyl monophosphate
  • inchi key:
    • InChIKey=YRXRHZOKDFCXIB-PYDDKJGSSA-L
  • molecular weight:
    • 374.499
  • Synonym(s):
    • phytolmonophosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C" cannot be used as a page name in this wiki.