Difference between revisions of "Tiso gene 5129"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7025 CPD-7025] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C * inchi key: *...") |
(Created page with "Category:Gene == Gene Tiso_gene_5129 == * right end position: ** 9832 * transcription direction: ** POSITIVE * left end position: ** 7359 * centisome position: ** 53.06843...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_5129 == |
− | * | + | * right end position: |
− | ** | + | ** 9832 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 7359 |
− | * | + | * centisome position: |
− | ** | + | ** 53.068436 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[BIS5-ADENOSYL-TRIPHOSPHATASE-RXN]] | |
− | * [[RXN- | + | ** Source: [[orthology-athaliana]] |
− | == | + | * Reaction: [[GSHTRAN-RXN]] |
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[GST-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-13673]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-15680]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7112]] | ||
+ | * [[PWY-6842]] | ||
+ | * [[PWY-4061]] | ||
+ | * [[PWY-7533]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=9832}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=7359}} | |
− | + | {{#set: centisome position=53.068436 }} | |
− | {{#set: | + | {{#set: reaction associated=BIS5-ADENOSYL-TRIPHOSPHATASE-RXN|GSHTRAN-RXN|GST-RXN|RXN-13673|RXN-15680}} |
− | {{#set: | + | {{#set: pathway associated=PWY-7112|PWY-6842|PWY-4061|PWY-7533}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 21:11, 21 March 2018
Gene Tiso_gene_5129
- right end position:
- 9832
- transcription direction:
- POSITIVE
- left end position:
- 7359
- centisome position:
- 53.068436
- Synonym(s):
Reactions associated
- Reaction: BIS5-ADENOSYL-TRIPHOSPHATASE-RXN
- Source: orthology-athaliana
- Reaction: GSHTRAN-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
- Reaction: GST-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
- Reaction: RXN-13673
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
- Reaction: RXN-15680
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation