Difference between revisions of "7Z-3-oxo-hexadec-7-enoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PSEUDOURIDINE-5-P PSEUDOURIDINE-5-P] == * smiles: ** C1(NC(=O)NC(=O)C=1C2(OC(COP(=O)([O-])[O-])...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7Z-3-oxo-hexadec-7-enoyl-ACPs 7Z-3-oxo-hexadec-7-enoyl-ACPs] == * common name: ** a (7Z)-3-oxo-...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PSEUDOURIDINE-5-P PSEUDOURIDINE-5-P] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7Z-3-oxo-hexadec-7-enoyl-ACPs 7Z-3-oxo-hexadec-7-enoyl-ACPs] ==
* smiles:
+
** C1(NC(=O)NC(=O)C=1C2(OC(COP(=O)([O-])[O-])C(O)C(O)2))
+
* inchi key:
+
** InChIKey=MOBMOJGXNHLLIR-GBNDHIKLSA-L
+
 
* common name:
 
* common name:
** pseudouridine 5'-phosphate
+
** a (7Z)-3-oxo-hexadec-7-enoyl-[acp]
* molecular weight:
+
** 322.168   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-16622]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-16621]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN0-5398]]
 
 
== External links  ==
 
== External links  ==
* CAS : 1157-60-4
+
{{#set: common name=a (7Z)-3-oxo-hexadec-7-enoyl-[acp]}}
* PUBCHEM:
+
{{#set: consumed by=RXN-16622}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245232 25245232]
+
{{#set: produced by=RXN-16621}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58380 58380]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C01168 C01168]
+
* HMDB : HMDB01271
+
{{#set: smiles=C1(NC(=O)NC(=O)C=1C2(OC(COP(=O)([O-])[O-])C(O)C(O)2))}}
+
{{#set: inchi key=InChIKey=MOBMOJGXNHLLIR-GBNDHIKLSA-L}}
+
{{#set: common name=pseudouridine 5'-phosphate}}
+
{{#set: molecular weight=322.168    }}
+
{{#set: consumed or produced by=RXN0-5398}}
+

Latest revision as of 20:11, 21 March 2018

Metabolite 7Z-3-oxo-hexadec-7-enoyl-ACPs

  • common name:
    • a (7Z)-3-oxo-hexadec-7-enoyl-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a (7Z)-3-oxo-hexadec-7-enoyl-[acp" cannot be used as a page name in this wiki.