Difference between revisions of "7Z-3-oxo-hexadec-7-enoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-725 CPD-725] == * smiles: ** CCC=CCC(C=CC=CCCCCCCCC([O-])=O)OO * inchi key: ** InChIKey=UYQ...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7Z-3-oxo-hexadec-7-enoyl-ACPs 7Z-3-oxo-hexadec-7-enoyl-ACPs] == * common name: ** a (7Z)-3-oxo-...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-725 CPD-725] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7Z-3-oxo-hexadec-7-enoyl-ACPs 7Z-3-oxo-hexadec-7-enoyl-ACPs] ==
* smiles:
+
** CCC=CCC(C=CC=CCCCCCCCC([O-])=O)OO
+
* inchi key:
+
** InChIKey=UYQGVDXDXBAABN-FQSPHKRJSA-M
+
 
* common name:
 
* common name:
** 13(S)-HPOTE
+
** a (7Z)-3-oxo-hexadec-7-enoyl-[acp]
* molecular weight:
+
** 309.425   
+
 
* Synonym(s):
 
* Synonym(s):
** 13(S)-hydroperoxylinolenic acid
 
** hydroperoxylinolenic acid
 
** 13S-hydroperoxy-9(Z),11(E),15(Z)-octadecatrienoic acid
 
** 13(S)-hydroperoxy-(9Z,11E,15Z)-octadecatrienoate
 
** 13(S)-hydroperoxylinolenate
 
** (9Z,11E,15Z)-(13S)-hydroperoxyoctadeca-9,11,15-trienoate
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-16622]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-1321]]
+
* [[RXN-16621]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a (7Z)-3-oxo-hexadec-7-enoyl-[acp]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266757 45266757]
+
{{#set: consumed by=RXN-16622}}
* CHEBI:
+
{{#set: produced by=RXN-16621}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58757 58757]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C04785 C04785]
+
{{#set: smiles=CCC=CCC(C=CC=CCCCCCCCC([O-])=O)OO}}
+
{{#set: inchi key=InChIKey=UYQGVDXDXBAABN-FQSPHKRJSA-M}}
+
{{#set: common name=13(S)-HPOTE}}
+
{{#set: molecular weight=309.425    }}
+
{{#set: common name=13(S)-hydroperoxylinolenic acid|hydroperoxylinolenic acid|13S-hydroperoxy-9(Z),11(E),15(Z)-octadecatrienoic acid|13(S)-hydroperoxy-(9Z,11E,15Z)-octadecatrienoate|13(S)-hydroperoxylinolenate|(9Z,11E,15Z)-(13S)-hydroperoxyoctadeca-9,11,15-trienoate}}
+
{{#set: produced by=RXN-1321}}
+

Latest revision as of 20:11, 21 March 2018

Metabolite 7Z-3-oxo-hexadec-7-enoyl-ACPs

  • common name:
    • a (7Z)-3-oxo-hexadec-7-enoyl-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a (7Z)-3-oxo-hexadec-7-enoyl-[acp" cannot be used as a page name in this wiki.