Difference between revisions of "CPD-16817"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIO-5-AMP BIO-5-AMP] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16817 CPD-16817] == * smiles: ** C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2)) * common name: **...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16817 CPD-16817] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2)) |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** indoxyl sulfate |
| + | * inchi key: | ||
| + | ** InChIKey=BXFFHSIDQOFMLE-UHFFFAOYSA-M | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 212.2 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** indol-3-yl sulfate |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-15587]] | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4453098 4453098] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=43355 43355] |
| − | + | * HMDB : HMDB00682 | |
| − | + | {{#set: smiles=C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2))}} | |
| − | * HMDB : | + | {{#set: common name=indoxyl sulfate}} |
| − | {{#set: smiles= | + | {{#set: inchi key=InChIKey=BXFFHSIDQOFMLE-UHFFFAOYSA-M}} |
| − | {{#set: | + | {{#set: molecular weight=212.2 }} |
| − | {{#set: | + | {{#set: common name=indol-3-yl sulfate}} |
| − | {{#set: molecular weight= | + | {{#set: reversible reaction associated=RXN-15587}} |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
Latest revision as of 20:11, 21 March 2018
Contents
Metabolite CPD-16817
- smiles:
- C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2))
- common name:
- indoxyl sulfate
- inchi key:
- InChIKey=BXFFHSIDQOFMLE-UHFFFAOYSA-M
- molecular weight:
- 212.2
- Synonym(s):
- indol-3-yl sulfate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2))" cannot be used as a page name in this wiki.
