Difference between revisions of "ALCDH nadp i"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIOTIN BIOTIN] == * smiles: ** C1(SC(CCCCC(=O)[O-])[CH]2(NC(=O)N[CH]12)) * inchi key: ** InChIK...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALCDH_nadp_i ALCDH_nadp_i] == * direction: ** LEFT-TO-RIGHT * common name: ** alcohol dehydrogenase...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIOTIN BIOTIN] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALCDH_nadp_i ALCDH_nadp_i] ==
−
* smiles:
+
* direction:
−
** C1(SC(CCCCC(=O)[O-])[CH]2(NC(=O)N[CH]12))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=YBJHBAHKTGYVGT-ZKWXMUAHSA-M
+
 
* common name:
 
* common name:
−
** biotin
+
** alcohol dehydrogenase (ethanol, NADP)
−
* molecular weight:
+
−
** 243.3   
+
 
* Synonym(s):
 
* Synonym(s):
−
** vitamin H
 
−
** coenzyme R
 
−
** d-biotin
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[6.3.4.11-RXN]]
+
* With identifiers:
−
* [[RXN0-7192]]
+
** 1.0 [[ACETALD]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[NADPH]][c] '''=>''' 1.0 [[ETOH]][c] '''+''' 1.0 [[NADP]][c]
−
* [[6.3.4.10-RXN]]
+
* With common name(s):
−
* [[6.3.4.9-RXN]]
+
** 1.0 acetaldehyde[c] '''+''' 1.0 H+[c] '''+''' 1.0 NADPH[c] '''=>''' 1.0 ethanol[c] '''+''' 1.0 NADP+[c]
−
* [[BIOTINLIG-RXN]]
+
 
−
== Reaction(s) known to produce the compound ==
+
== Genes associated with this reaction  ==
−
* [[2.8.1.6-RXN]]
+
Genes have been associated with this reaction based on different elements listed below.
−
* [[RXN-17473]]
+
* Gene: [[Tiso_gene_14126]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 58-85-5
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* METABOLIGHTS : MTBLC57586
+
{{#set: common name=alcohol dehydrogenase (ethanol, NADP)}}
−
* PUBCHEM:
+
{{#set: gene associated=Tiso_gene_14126}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6560210 6560210]
+
{{#set: in pathway=}}
−
* HMDB : HMDB00030
+
{{#set: reconstruction category=orthology}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00120 C00120]
+
{{#set: reconstruction tool=pantograph}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.5028036.html 5028036]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57586 57586]
+
−
* BIGG : btn
+
−
{{#set: smiles=C1(SC(CCCCC(=O)[O-])[CH]2(NC(=O)N[CH]12))}}
+
−
{{#set: inchi key=InChIKey=YBJHBAHKTGYVGT-ZKWXMUAHSA-M}}
+
−
{{#set: common name=biotin}}
+
−
{{#set: molecular weight=243.3    }}
+
−
{{#set: common name=vitamin H|coenzyme R|d-biotin}}
+
−
{{#set: consumed by=6.3.4.11-RXN|RXN0-7192|6.3.4.10-RXN|6.3.4.9-RXN|BIOTINLIG-RXN}}
+
−
{{#set: produced by=2.8.1.6-RXN|RXN-17473}}
+

Latest revision as of 20:11, 21 March 2018

Reaction ALCDH_nadp_i

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • alcohol dehydrogenase (ethanol, NADP)
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 acetaldehyde[c] + 1.0 H+[c] + 1.0 NADPH[c] => 1.0 ethanol[c] + 1.0 NADP+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ALCDH_nadp_i&oldid=46724"