Difference between revisions of "BIO-5-AMP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DGTCY DGTCY] == * direction: ** LEFT-TO-RIGHT * common name: ** dGTP:cytidine 5'-phosphotransferase...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIO-5-AMP BIO-5-AMP] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DGTCY DGTCY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIO-5-AMP BIO-5-AMP] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)OC(=O)CCCCC4(SC[CH]5(NC(=O)N[CH]45))
 
* common name:
 
* common name:
−
** dGTP:cytidine 5'-phosphotransferase
+
** biotinyl-5'-adenylate
 +
* inchi key:
 +
** InChIKey=UTQCSTJVMLODHM-RHCAYAJFSA-M
 +
* molecular weight:
 +
** 572.509   
 
* Synonym(s):
 
* Synonym(s):
 +
** biotinyl-5'-AMP
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1.0 [[CYTIDINE]][c] '''+''' 1.0 [[DGTP]][c] '''=>''' 1.0 [[CMP]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[DGDP]][c]
+
* [[RXN0-7192]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 cytidine[c] '''+''' 1.0 dGTP[c] '''=>''' 1.0 CMP[c] '''+''' 1.0 H+[c] '''+''' 1.0 dGDP[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_14474]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[Tiso_gene_20134]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=dGTP:cytidine 5'-phosphotransferase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53239798 53239798]
−
{{#set: gene associated=Tiso_gene_14474|Tiso_gene_20134}}
+
* HMDB : HMDB04220
−
{{#set: in pathway=}}
+
* CHEBI:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62414 62414]
−
{{#set: reconstruction tool=pantograph}}
+
* LIGAND-CPD:
−
{{#set: reconstruction source=creinhardtii}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C05921 C05921]
 +
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)OC(=O)CCCCC4(SC[CH]5(NC(=O)N[CH]45))}}
 +
{{#set: common name=biotinyl-5'-adenylate}}
 +
{{#set: inchi key=InChIKey=UTQCSTJVMLODHM-RHCAYAJFSA-M}}
 +
{{#set: molecular weight=572.509    }}
 +
{{#set: common name=biotinyl-5'-AMP}}
 +
{{#set: produced by=RXN0-7192}}

Latest revision as of 20:11, 21 March 2018

Metabolite BIO-5-AMP

  • smiles:
    • C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)OC(=O)CCCCC4(SC[CH]5(NC(=O)N[CH]45))
  • common name:
    • biotinyl-5'-adenylate
  • inchi key:
    • InChIKey=UTQCSTJVMLODHM-RHCAYAJFSA-M
  • molecular weight:
    • 572.509
  • Synonym(s):
    • biotinyl-5'-AMP

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)OC(=O)CCCCC4(SC[CH]5(NC(=O)N[CH]45))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=BIO-5-AMP&oldid=46725"