Difference between revisions of "Tiso gene 2704"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIO-5-AMP BIO-5-AMP] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)...")
 
(Created page with "Category:Gene == Gene Tiso_gene_2704 == * Synonym(s): == Reactions associated == * Reaction: RXN-6622 ** Source: orthology-athaliana ** Source: orthology-synech...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIO-5-AMP BIO-5-AMP] ==
+
== Gene Tiso_gene_2704 ==
* smiles:
+
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)OC(=O)CCCCC4(SC[CH]5(NC(=O)N[CH]45))
+
* inchi key:
+
** InChIKey=UTQCSTJVMLODHM-RHCAYAJFSA-M
+
* common name:
+
** biotinyl-5'-adenylate
+
* molecular weight:
+
** 572.509   
+
 
* Synonym(s):
 
* Synonym(s):
** biotinyl-5'-AMP
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-6622]]
* [[RXN0-7192]]
+
** Source: [[orthology-athaliana]]
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-synechocystis]]
 +
== Pathways associated ==
 +
* [[PWY-4041]]
 +
* [[PWY-7559]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=RXN-6622}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53239798 53239798]
+
{{#set: pathway associated=PWY-4041|PWY-7559}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62414 62414]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C05921 C05921]
+
* HMDB : HMDB04220
+
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)OC(=O)CCCCC4(SC[CH]5(NC(=O)N[CH]45))}}
+
{{#set: inchi key=InChIKey=UTQCSTJVMLODHM-RHCAYAJFSA-M}}
+
{{#set: common name=biotinyl-5'-adenylate}}
+
{{#set: molecular weight=572.509    }}
+
{{#set: common name=biotinyl-5'-AMP}}
+
{{#set: produced by=RXN0-7192}}
+

Latest revision as of 20:11, 21 March 2018

Gene Tiso_gene_2704

  • Synonym(s):

Reactions associated

Pathways associated

External links