Difference between revisions of "Heparan-sulfate-L-IdoA-2S"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-637 CPD-637] == * smiles: ** CC1(C(=C(C=CC=1)O)C([O-])=O) * inchi key: ** InChIKey=HCJMNOSI...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Heparan-sulfate-L-IdoA-2S Heparan-sulfate-L-IdoA-2S] == * common name: ** a [heparan-sulfate]-2...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-637 CPD-637] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Heparan-sulfate-L-IdoA-2S Heparan-sulfate-L-IdoA-2S] ==
* smiles:
+
** CC1(C(=C(C=CC=1)O)C([O-])=O)
+
* inchi key:
+
** InChIKey=HCJMNOSIAGSZBM-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
** 6-methylsalicylate
+
** a [heparan-sulfate]-2-O-sulfo-α-L-iduronate
* molecular weight:
+
** 151.141   
+
 
* Synonym(s):
 
* Synonym(s):
** Methylsalicylic acid
 
** 6-Methyl 2-hydroxybenzenecarboxylate
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3.1.6.13-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.3.1.165-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a [heparan-sulfate]-2-O-sulfo-α-L-iduronate}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54693536 54693536]
+
{{#set: consumed by=3.1.6.13-RXN}}
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.5342108.html 5342108]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=36658 36658]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C02657 C02657]
+
{{#set: smiles=CC1(C(=C(C=CC=1)O)C([O-])=O)}}
+
{{#set: inchi key=InChIKey=HCJMNOSIAGSZBM-UHFFFAOYSA-M}}
+
{{#set: common name=6-methylsalicylate}}
+
{{#set: molecular weight=151.141    }}
+
{{#set: common name=Methylsalicylic acid|6-Methyl 2-hydroxybenzenecarboxylate}}
+
{{#set: produced by=2.3.1.165-RXN}}
+

Latest revision as of 21:12, 21 March 2018

Metabolite Heparan-sulfate-L-IdoA-2S

  • common name:
    • a [heparan-sulfate]-2-O-sulfo-α-L-iduronate
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [heparan-sulfate]-2-O-sulfo-α-L-iduronate" cannot be used as a page name in this wiki.