Difference between revisions of "BIOTIN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5Z-3-oxo-tetradec-5-enoyl-ACPs 5Z-3-oxo-tetradec-5-enoyl-ACPs] == * common name: ** a (5Z)-3-ox...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIOTIN BIOTIN] == * smiles: ** C1(SC(CCCCC(=O)[O-])[CH]2(NC(=O)N[CH]12)) * common name: ** biot...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIOTIN BIOTIN] == |
| + | * smiles: | ||
| + | ** C1(SC(CCCCC(=O)[O-])[CH]2(NC(=O)N[CH]12)) | ||
* common name: | * common name: | ||
| − | ** | + | ** biotin |
| + | * inchi key: | ||
| + | ** InChIKey=YBJHBAHKTGYVGT-ZKWXMUAHSA-M | ||
| + | * molecular weight: | ||
| + | ** 243.3 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** vitamin H |
| − | ** | + | ** coenzyme R |
| + | ** d-biotin | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[6.3.4.11-RXN]] |
| + | * [[RXN0-7192]] | ||
| + | * [[6.3.4.10-RXN]] | ||
| + | * [[6.3.4.9-RXN]] | ||
| + | * [[BIOTINLIG-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[2.8.1.6-RXN]] |
| + | * [[RXN-17473]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 58-85-5 |
| − | {{#set: common name= | + | * BIGG : btn |
| − | {{#set: consumed by=RXN- | + | * PUBCHEM: |
| − | {{#set: produced by=RXN- | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6560210 6560210] |
| + | * HMDB : HMDB00030 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00120 C00120] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.5028036.html 5028036] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57586 57586] | ||
| + | * METABOLIGHTS : MTBLC57586 | ||
| + | {{#set: smiles=C1(SC(CCCCC(=O)[O-])[CH]2(NC(=O)N[CH]12))}} | ||
| + | {{#set: common name=biotin}} | ||
| + | {{#set: inchi key=InChIKey=YBJHBAHKTGYVGT-ZKWXMUAHSA-M}} | ||
| + | {{#set: molecular weight=243.3 }} | ||
| + | {{#set: common name=vitamin H|coenzyme R|d-biotin}} | ||
| + | {{#set: consumed by=6.3.4.11-RXN|RXN0-7192|6.3.4.10-RXN|6.3.4.9-RXN|BIOTINLIG-RXN}} | ||
| + | {{#set: produced by=2.8.1.6-RXN|RXN-17473}} | ||
Latest revision as of 20:12, 21 March 2018
Contents
Metabolite BIOTIN
- smiles:
- C1(SC(CCCCC(=O)[O-])[CH]2(NC(=O)N[CH]12))
- common name:
- biotin
- inchi key:
- InChIKey=YBJHBAHKTGYVGT-ZKWXMUAHSA-M
- molecular weight:
- 243.3
- Synonym(s):
- vitamin H
- coenzyme R
- d-biotin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 58-85-5
- BIGG : btn
- PUBCHEM:
- HMDB : HMDB00030
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC57586
"C1(SC(CCCCC(=O)[O-])[CH]2(NC(=O)N[CH]12))" cannot be used as a page name in this wiki.
