Difference between revisions of "MAL"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Unwound-RNA Unwound-RNA] == * common name: ** an unwound RNA * Synonym(s): == Reaction(s) know...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MAL MAL] == * smiles: ** C(=O)([O-])CC(O)C([O-])=O * common name: ** (S)-malate * inchi key: **...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MAL MAL] == |
| + | * smiles: | ||
| + | ** C(=O)([O-])CC(O)C([O-])=O | ||
* common name: | * common name: | ||
| − | ** | + | ** (S)-malate |
| + | * inchi key: | ||
| + | ** InChIKey=BJEPYKJPYRNKOW-REOHCLBHSA-L | ||
| + | * molecular weight: | ||
| + | ** 132.073 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** (S)-malic acid | ||
| + | ** L-apple acid | ||
| + | ** L-malic acid | ||
| + | ** L-hydroxysuccinic acid | ||
| + | ** L-hydroxybutanedioic acid | ||
| + | ** L-malate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[1.1.1.39-RXN]] | ||
| + | * [[MALIC-NADP-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[MALSYN-RXN]] |
| + | * [[RXN-6002]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[MALATE-DEH-RXN]] | ||
| + | * [[FUMHYDR-RXN]] | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * CAS : 6915-15-7 |
| − | {{#set: produced by=RXN- | + | * CAS : 97-67-6 |
| + | * BIGG : mal__L | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459792 5459792] | ||
| + | * HMDB : HMDB00156 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00149 C00149] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.4573566.html 4573566] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15589 15589] | ||
| + | * METABOLIGHTS : MTBLC15589 | ||
| + | {{#set: smiles=C(=O)([O-])CC(O)C([O-])=O}} | ||
| + | {{#set: common name=(S)-malate}} | ||
| + | {{#set: inchi key=InChIKey=BJEPYKJPYRNKOW-REOHCLBHSA-L}} | ||
| + | {{#set: molecular weight=132.073 }} | ||
| + | {{#set: common name=(S)-malic acid|L-apple acid|L-malic acid|L-hydroxysuccinic acid|L-hydroxybutanedioic acid|L-malate}} | ||
| + | {{#set: consumed by=1.1.1.39-RXN|MALIC-NADP-RXN}} | ||
| + | {{#set: produced by=MALSYN-RXN|RXN-6002}} | ||
| + | {{#set: reversible reaction associated=MALATE-DEH-RXN|FUMHYDR-RXN}} | ||
Latest revision as of 20:12, 21 March 2018
Contents
Metabolite MAL
- smiles:
- C(=O)([O-])CC(O)C([O-])=O
- common name:
- (S)-malate
- inchi key:
- InChIKey=BJEPYKJPYRNKOW-REOHCLBHSA-L
- molecular weight:
- 132.073
- Synonym(s):
- (S)-malic acid
- L-apple acid
- L-malic acid
- L-hydroxysuccinic acid
- L-hydroxybutanedioic acid
- L-malate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 6915-15-7
- CAS : 97-67-6
- BIGG : mal__L
- PUBCHEM:
- HMDB : HMDB00156
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC15589
"C(=O)([O-])CC(O)C([O-])=O" cannot be used as a page name in this wiki.
