Difference between revisions of "ALCDH nadp hi"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-D-LACTONE GLC-D-LACTONE] == * smiles: ** C(O)C1(OC(C(C(C1O)O)O)=O) * inchi key: ** InChIKey...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALCDH_nadp_hi ALCDH_nadp_hi] == * direction: ** LEFT-TO-RIGHT * common name: ** alcohol dehydrogena...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-D-LACTONE GLC-D-LACTONE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALCDH_nadp_hi ALCDH_nadp_hi] ==
−
* smiles:
+
* direction:
−
** C(O)C1(OC(C(C(C1O)O)O)=O)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=PHOQVHQSTUBQQK-SQOUGZDYSA-N
+
 
* common name:
 
* common name:
−
** D-glucono-1,5-lactone
+
** alcohol dehydrogenase (ethanol, NADP), chloroplast
−
* molecular weight:
+
−
** 178.141   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-one
 
−
** gluconolactone
 
−
** glucono-1,5-lactone
 
−
** 1,5-gluconolactone
 
−
** D-gluconolactone
 
−
** glucono-δ-lactone
 
−
** δ-gluconolactone
 
−
** D-glucono-δ-lactone
 
−
** gluconic lactone
 
−
** gluconic acid lactone
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[GLUCONOLACT-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[ACETALD]][h] '''+''' 1.0 [[PROTON]][h] '''+''' 1.0 [[NADPH]][h] '''=>''' 1.0 [[ETOH]][h] '''+''' 1.0 [[NADP]][h]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[RXN-11334]]
+
** 1.0 acetaldehyde[h] '''+''' 1.0 H+[h] '''+''' 1.0 NADPH[h] '''=>''' 1.0 ethanol[h] '''+''' 1.0 NADP+[h]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_14126]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 90-80-2
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* DRUGBANK : DB04564
+
{{#set: common name=alcohol dehydrogenase (ethanol, NADP), chloroplast}}
−
* PUBCHEM:
+
{{#set: gene associated=Tiso_gene_14126}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7027 7027]
+
{{#set: in pathway=}}
−
* HMDB : HMDB00150
+
{{#set: reconstruction category=orthology}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00198 C00198]
+
{{#set: reconstruction tool=pantograph}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.6760.html 6760]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16217 16217]
+
−
{{#set: smiles=C(O)C1(OC(C(C(C1O)O)O)=O)}}
+
−
{{#set: inchi key=InChIKey=PHOQVHQSTUBQQK-SQOUGZDYSA-N}}
+
−
{{#set: common name=D-glucono-1,5-lactone}}
+
−
{{#set: molecular weight=178.141    }}
+
−
{{#set: common name=3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-one|gluconolactone|glucono-1,5-lactone|1,5-gluconolactone|D-gluconolactone|glucono-δ-lactone|δ-gluconolactone|D-glucono-δ-lactone|gluconic lactone|gluconic acid lactone}}
+
−
{{#set: consumed by=GLUCONOLACT-RXN}}
+
−
{{#set: reversible reaction associated=RXN-11334}}
+

Latest revision as of 21:12, 21 March 2018

Reaction ALCDH_nadp_hi

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • alcohol dehydrogenase (ethanol, NADP), chloroplast
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 acetaldehyde[h] + 1.0 H+[h] + 1.0 NADPH[h] => 1.0 ethanol[h] + 1.0 NADP+[h]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ALCDH_nadp_hi&oldid=46746"