Difference between revisions of "ALCDH nadp hi"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MAL MAL] == * smiles: ** C(=O)([O-])CC(O)C([O-])=O * inchi key: ** InChIKey=BJEPYKJPYRNKOW-REOH...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALCDH_nadp_hi ALCDH_nadp_hi] == * direction: ** LEFT-TO-RIGHT * common name: ** alcohol dehydrogena...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MAL MAL] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALCDH_nadp_hi ALCDH_nadp_hi] ==
* smiles:
+
* direction:
** C(=O)([O-])CC(O)C([O-])=O
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=BJEPYKJPYRNKOW-REOHCLBHSA-L
+
 
* common name:
 
* common name:
** (S)-malate
+
** alcohol dehydrogenase (ethanol, NADP), chloroplast
* molecular weight:
+
** 132.073   
+
 
* Synonym(s):
 
* Synonym(s):
** (S)-malic acid
 
** L-apple acid
 
** L-malic acid
 
** L-hydroxysuccinic acid
 
** L-hydroxybutanedioic acid
 
** L-malate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[1.1.1.39-RXN]]
+
* With identifiers:
* [[MALIC-NADP-RXN]]
+
** 1.0 [[ACETALD]][h] '''+''' 1.0 [[PROTON]][h] '''+''' 1.0 [[NADPH]][h] '''=>''' 1.0 [[ETOH]][h] '''+''' 1.0 [[NADP]][h]
== Reaction(s) known to produce the compound ==
+
* With common name(s):
* [[MALSYN-RXN]]
+
** 1.0 acetaldehyde[h] '''+''' 1.0 H+[h] '''+''' 1.0 NADPH[h] '''=>''' 1.0 ethanol[h] '''+''' 1.0 NADP+[h]
* [[RXN-6002]]
+
 
== Reaction(s) of unknown directionality ==
+
== Genes associated with this reaction  ==
* [[MALATE-DEH-RXN]]
+
Genes have been associated with this reaction based on different elements listed below.
* [[FUMHYDR-RXN]]
+
* Gene: [[Tiso_gene_14126]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* CAS : 6915-15-7
+
{{#set: direction=LEFT-TO-RIGHT}}
* CAS : 97-67-6
+
{{#set: common name=alcohol dehydrogenase (ethanol, NADP), chloroplast}}
* METABOLIGHTS : MTBLC15589
+
{{#set: gene associated=Tiso_gene_14126}}
* PUBCHEM:
+
{{#set: in pathway=}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459792 5459792]
+
{{#set: reconstruction category=orthology}}
* HMDB : HMDB00156
+
{{#set: reconstruction source=orthology-creinhardtii}}
* LIGAND-CPD:
+
{{#set: reconstruction tool=pantograph}}
** [http://www.genome.jp/dbget-bin/www_bget?C00149 C00149]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.4573566.html 4573566]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15589 15589]
+
* BIGG : mal__L
+
{{#set: smiles=C(=O)([O-])CC(O)C([O-])=O}}
+
{{#set: inchi key=InChIKey=BJEPYKJPYRNKOW-REOHCLBHSA-L}}
+
{{#set: common name=(S)-malate}}
+
{{#set: molecular weight=132.073    }}
+
{{#set: common name=(S)-malic acid|L-apple acid|L-malic acid|L-hydroxysuccinic acid|L-hydroxybutanedioic acid|L-malate}}
+
{{#set: consumed by=1.1.1.39-RXN|MALIC-NADP-RXN}}
+
{{#set: produced by=MALSYN-RXN|RXN-6002}}
+
{{#set: consumed or produced by=MALATE-DEH-RXN|FUMHYDR-RXN}}
+

Latest revision as of 21:12, 21 March 2018

Reaction ALCDH_nadp_hi

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • alcohol dehydrogenase (ethanol, NADP), chloroplast
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 acetaldehyde[h] + 1.0 H+[h] + 1.0 NADPH[h] => 1.0 ethanol[h] + 1.0 NADP+[h]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links