Difference between revisions of "Tiso gene 5527"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-206 CPD-206] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...")
(Created page with "Category:Gene == Gene Tiso_gene_5527 == * right end position: ** 11299 * transcription direction: ** POSITIVE * left end position: ** 10533 * centisome position: ** 79.141...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-206 CPD-206] ==
+
== Gene Tiso_gene_5527 ==
* smiles:
+
* right end position:
** CC(C)CCCC(C)CCCC(C)CCCC(C)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** 11299
* inchi key:
+
* transcription direction:
** InChIKey=NRJQGHHZMSOUEN-HHVNVSIESA-J
+
** POSITIVE
* common name:
+
* left end position:
** phytanoyl-CoA
+
** 10533
* molecular weight:
+
* centisome position:
** 1058.022    
+
** 79.14193    
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[1.14.11.18-RXN]]
+
* Reaction: [[ATPASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
* [[RXN66-482]]
+
*** Assignment: ec-number
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=11299}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658363 90658363]
+
{{#set: transcription direction=POSITIVE}}
* CHEBI:
+
{{#set: left end position=10533}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15538 15538]
+
{{#set: centisome position=79.14193   }}
* LIGAND-CPD:
+
{{#set: reaction associated=ATPASE-RXN}}
** [http://www.genome.jp/dbget-bin/www_bget?C02060 C02060]
+
* HMDB : HMDB01359
+
{{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: inchi key=InChIKey=NRJQGHHZMSOUEN-HHVNVSIESA-J}}
+
{{#set: common name=phytanoyl-CoA}}
+
{{#set: molecular weight=1058.022   }}
+
{{#set: consumed by=1.14.11.18-RXN}}
+
{{#set: produced by=RXN66-482}}
+

Latest revision as of 21:12, 21 March 2018

Gene Tiso_gene_5527

  • right end position:
    • 11299
  • transcription direction:
    • POSITIVE
  • left end position:
    • 10533
  • centisome position:
    • 79.14193
  • Synonym(s):

Reactions associated

Pathways associated

External links