Difference between revisions of "Tiso gene 5527"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-120 CPD1F-120] == * smiles: ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-]...")
(Created page with "Category:Gene == Gene Tiso_gene_5527 == * right end position: ** 11299 * transcription direction: ** POSITIVE * left end position: ** 10533 * centisome position: ** 79.141...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-120 CPD1F-120] ==
+
== Gene Tiso_gene_5527 ==
−
* smiles:
+
* right end position:
−
** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
+
** 11299
−
* inchi key:
+
* transcription direction:
−
** InChIKey=QQRSSHFHXYSOMF-CXXOJBQZSA-L
+
** POSITIVE
−
* common name:
+
* left end position:
−
** gibberellin A24
+
** 10533
−
* molecular weight:
+
* centisome position:
−
** 344.407    
+
** 79.14193    
 
* Synonym(s):
 
* Synonym(s):
−
** GA24
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ATPASE-RXN]]
−
* [[RXN1F-163]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=11299}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246232 25246232]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=10533}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32906 32906]
+
{{#set: centisome position=79.14193   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=ATPASE-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11861 C11861]
+
−
* HMDB : HMDB37103
+
−
{{#set: smiles=C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
+
−
{{#set: inchi key=InChIKey=QQRSSHFHXYSOMF-CXXOJBQZSA-L}}
+
−
{{#set: common name=gibberellin A24}}
+
−
{{#set: molecular weight=344.407   }}
+
−
{{#set: common name=GA24}}
+
−
{{#set: produced by=RXN1F-163}}
+

Latest revision as of 20:12, 21 March 2018

Gene Tiso_gene_5527

  • right end position:
    • 11299
  • transcription direction:
    • POSITIVE
  • left end position:
    • 10533
  • centisome position:
    • 79.14193
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_5527&oldid=46748"