Difference between revisions of "3.4.24.64-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-1-P GLC-1-P] == * smiles: ** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * inchi key: ** InCh...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.4.24.64-RXN 3.4.24.64-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** mitochondrial_proce...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.4.24.64-RXN 3.4.24.64-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** mitochondrial_processing_peptidase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.4.24.64 EC-3.4.24.64] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * | + | * With identifiers: |
− | * [[ | + | ** 1 [[WATER]][c] '''+''' 1 [[Mitochondrial-Preproteins]][c] '''=>''' 1 [[Peptides-holder]][c] '''+''' 1 [[Processed-Mitochondrial-Proteins]][c] |
− | + | * With common name(s): | |
− | + | ** 1 H2O[c] '''+''' 1 a mitochondrial preprotein including a mitochondrial targeting sequence[c] '''=>''' 1 a peptide[c] '''+''' 1 a processed mitochondrial protein[c] | |
− | + | ||
− | + | == Genes associated with this reaction == | |
− | + | Genes have been associated with this reaction based on different elements listed below. | |
− | + | * Gene: [[Tiso_gene_5405]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | + | *** Assignment: AUTOMATED-NAME-MATCH | |
− | == | + | ** Source: [[annotation-experimental_annotation]] |
− | * [[ | + | *** Assignment: AUTOMATED-NAME-MATCH |
− | * [[ | + | == Pathways == |
− | * | + | == Reconstruction information == |
− | * | + | * Category: [[annotation]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * | + | *** Tool: [[pathwaytools]] |
− | * [[ | + | ** Source: [[annotation-experimental_annotation]] |
− | * [[ | + | *** Tool: [[pathwaytools]] |
− | * [[ | + | |
− | * [[ | + | |
− | * | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | * | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/P11913 P11913] |
− | * | + | ** [http://www.uniprot.org/uniprot/P20069 P20069] |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/P23955 P23955] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9T2S9 Q9T2S9] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9T2S8 Q9T2S8] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P10507 P10507] |
− | * | + | ** [http://www.uniprot.org/uniprot/P29677 P29677] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q03346 Q03346] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q41440 Q41440] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9UG64 Q9UG64] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9P7X1 Q9P7X1] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P11914 P11914] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: | + | {{#set: common name=mitochondrial_processing_peptidase}} |
− | {{#set: | + | {{#set: ec number=EC-3.4.24.64}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_5405}} |
− | {{#set: | + | {{#set: in pathway=}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}} |
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 20:12, 21 March 2018
Contents
Reaction 3.4.24.64-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- mitochondrial_processing_peptidase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 Mitochondrial-Preproteins[c] => 1 Peptides-holder[c] + 1 Processed-Mitochondrial-Proteins[c]
- With common name(s):
- 1 H2O[c] + 1 a mitochondrial preprotein including a mitochondrial targeting sequence[c] => 1 a peptide[c] + 1 a processed mitochondrial protein[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_5405
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-experimental_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links